tert-butyl 4-((6-((4-(benzo[d]thiazol-5-yl)-5-fluoropyrimidin-2-yl)amino)pyridin-3-yl)methyl)piperazine-1-carboxylate

ID: ALA5286388

Max Phase: Preclinical

Molecular Formula: C26H28FN7O2S

Molecular Weight: 521.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)N1CCN(Cc2ccc(Nc3ncc(F)c(-c4ccc5scnc5c4)n3)nc2)CC1

Standard InChI:  InChI=1S/C26H28FN7O2S/c1-26(2,3)36-25(35)34-10-8-33(9-11-34)15-17-4-7-22(28-13-17)31-24-29-14-19(27)23(32-24)18-5-6-21-20(12-18)30-16-37-21/h4-7,12-14,16H,8-11,15H2,1-3H3,(H,28,29,31,32)

Standard InChI Key:  JPOMSVWUCYBXCX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    3.2138    2.2636    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138    1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9275    1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9275    0.2001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2111   -0.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2111   -1.0362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4946   -1.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4946   -2.2691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7750   -2.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0636   -2.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463   -2.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3654   -2.2521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0851   -2.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7908   -2.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7908   -1.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5009   -0.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5009   -0.1680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2089    0.2556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2089    1.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9275   -0.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9191    0.6752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2195   -1.3980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0711   -1.0056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3654   -1.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0636   -1.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7833   -1.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    0.2023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4986    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7841    1.4398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7841    2.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696    2.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3551    2.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4291    2.5197    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9141    1.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4291    1.1847    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3551    1.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0696    1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
 16 22  2  0
 15 23  1  0
 23 24  1  0
 24 12  1  0
 10 25  1  0
 25 26  2  0
 26  7  1  0
  5 27  1  0
 27 28  2  0
 28  2  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 32  1  0
 36 37  2  0
 37 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286388

    ---

Associated Targets(Human)

DYRK2 Tchem Dual-specificity tyrosine-phosphorylation regulated kinase 2 (2095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.62Molecular Weight (Monoisotopic): 521.2009AlogP: 5.08#Rotatable Bonds: 5
Polar Surface Area: 96.37Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.28CX Basic pKa: 5.93CX LogP: 4.55CX LogD: 4.54
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.39Np Likeness Score: -1.73

References

1. Yuan K, Shen H, Zheng M, Xia F, Li Q, Chen W, Ji M, Yang H, Zhuang X, Cai Z, Min W, Wang X, Xiao Y, Yang P..  (2023)  Discovery of Potent DYRK2 Inhibitors with High Selectivity, Great Solubility, and Excellent Safety Properties for the Treatment of Prostate Cancer.,  66  (6): [PMID:36800260] [10.1021/acs.jmedchem.3c00106]

Source