The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(2-(2-((4-(4-chlorobenzyl)-1-oxophthalazin-2(1H)-yl)methyl)pyrrolidin-1-yl)ethyl)-4-methoxybutanamide Hydrochloride ID: ALA5286389
Max Phase: Preclinical
Molecular Formula: C27H34Cl2N4O3
Molecular Weight: 497.04
Associated Items:
Names and Identifiers Canonical SMILES: COCCCC(=O)NCCN1CCC[C@@H]1Cn1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O.Cl
Standard InChI: InChI=1S/C27H33ClN4O3.ClH/c1-35-17-5-9-26(33)29-14-16-31-15-4-6-22(31)19-32-27(34)24-8-3-2-7-23(24)25(30-32)18-20-10-12-21(28)13-11-20;/h2-3,7-8,10-13,22H,4-6,9,14-19H2,1H3,(H,29,33);1H/t22-;/m1./s1
Standard InChI Key: AHCZFQKDSCADKT-VZYDHVRKSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
2.2759 -1.4060 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.5587 -3.4316 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.8442 -3.0190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8442 -2.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1341 -1.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4166 -2.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4166 -3.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1295 -3.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7022 -1.7836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7022 -0.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9878 -0.5462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9878 0.2787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2733 0.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5588 0.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4727 -0.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3338 -0.7127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7460 0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1942 0.6140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4078 1.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2044 1.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4181 2.4213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2149 2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7982 2.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5952 2.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1785 1.6816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9753 1.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5587 1.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4284 3.4316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7022 0.6912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7022 1.5160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4167 0.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4167 -0.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1265 -0.9579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8427 -0.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8427 0.2783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1283 0.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
8 7 1 0
3 8 2 0
9 6 1 0
10 9 1 0
10 11 2 0
11 12 1 0
12 13 1 0
14 13 1 6
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
18 14 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
22 28 2 0
12 29 1 0
29 30 2 0
31 29 1 0
32 31 2 0
32 10 1 0
33 32 1 0
34 33 2 0
35 34 1 0
36 35 2 0
31 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.04Molecular Weight (Monoisotopic): 496.2241AlogP: 3.65#Rotatable Bonds: 11Polar Surface Area: 76.46Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.29CX LogP: 3.35CX LogD: 3.11Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.32
References 1. Procopiou PA, Ford AJ, Gore PM, Looker BE, Hodgson ST, Holmes DS, Vile S, Clark KL, Saunders KA, Slack RJ, Rowedder JE, Watts CJ.. (2017) Design of Phthalazinone Amide Histamine H1 Receptor Antagonists for Use in Rhinitis., 8 (5): [PMID:28523114 ] [10.1021/acsmedchemlett.7b00112 ]