2-amino-5'-fluoro-2',5-dioxo-5H-spiro[indeno[1,2-b]pyran-4,3'-indoline]-3-carbonitrile

ID: ALA5286477

Max Phase: Preclinical

Molecular Formula: C20H10FN3O3

Molecular Weight: 359.32

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#CC1=C(N)OC2=C(C(=O)c3ccccc32)C12C(=O)Nc1ccc(F)cc12

Standard InChI:  InChI=1S/C20H10FN3O3/c21-9-5-6-14-12(7-9)20(19(26)24-14)13(8-22)18(23)27-17-11-4-2-1-3-10(11)16(25)15(17)20/h1-7H,23H2,(H,24,26)

Standard InChI Key:  MSDXLCJSAMEJBC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   -2.4542   -0.5651    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7397   -0.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7397   -1.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0235   -2.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3135   -1.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4692   -2.0481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9612   -1.3806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5243   -1.3806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4904   -0.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2874   -0.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8708   -1.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4542   -1.6804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5009    0.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2979    0.4968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9175    0.8667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1206    0.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5718    1.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6966    1.9165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4701    2.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1136    1.6978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9892    0.8778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2197    0.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9342   -0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6488   -0.5898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0929   -0.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3135   -0.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0253   -0.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9  7  1  0
  9 10  1  0
 11 10  1  0
 11 12  3  0
 10 13  2  0
 13 14  1  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 22 21  1  0
 17 22  2  0
 23 22  1  0
 23 24  2  0
 25 23  1  0
 16 25  2  0
  9 25  1  0
 26  9  1  0
  5 26  2  0
 26 27  1  0
 27  2  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5286477

    ---

Associated Targets(Human)

MDA-MB-435 (38290 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 359.32Molecular Weight (Monoisotopic): 359.0706AlogP: 2.35#Rotatable Bonds:
Polar Surface Area: 105.21Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.93CX Basic pKa: 1.51CX LogP: 1.47CX LogD: 1.47
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.75Np Likeness Score: -0.54

References

1. Bora D, Kaushal A, Shankaraiah N..  (2021)  Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition.,  215  [PMID:33601313] [10.1016/j.ejmech.2021.113263]

Source