The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-5'-fluoro-2',5-dioxo-5H-spiro[indeno[1,2-b]pyran-4,3'-indoline]-3-carbonitrile ID: ALA5286477
Max Phase: Preclinical
Molecular Formula: C20H10FN3O3
Molecular Weight: 359.32
Associated Items:
Names and Identifiers Canonical SMILES: N#CC1=C(N)OC2=C(C(=O)c3ccccc32)C12C(=O)Nc1ccc(F)cc12
Standard InChI: InChI=1S/C20H10FN3O3/c21-9-5-6-14-12(7-9)20(19(26)24-14)13(8-22)18(23)27-17-11-4-2-1-3-10(11)16(25)15(17)20/h1-7H,23H2,(H,24,26)
Standard InChI Key: MSDXLCJSAMEJBC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 31 0 0 0 0 0 0 0 0999 V2000
-2.4542 -0.5651 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7397 -0.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7397 -1.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0235 -2.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3135 -1.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4692 -2.0481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9612 -1.3806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5243 -1.3806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4904 -0.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2874 -0.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8708 -1.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4542 -1.6804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5009 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2979 0.4968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9175 0.8667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1206 0.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5718 1.0932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6966 1.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4701 2.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1136 1.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9892 0.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2197 0.5758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9342 -0.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6488 -0.5898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0929 -0.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3135 -0.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0253 -0.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
9 7 1 0
9 10 1 0
11 10 1 0
11 12 3 0
10 13 2 0
13 14 1 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
22 21 1 0
17 22 2 0
23 22 1 0
23 24 2 0
25 23 1 0
16 25 2 0
9 25 1 0
26 9 1 0
5 26 2 0
26 27 1 0
27 2 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 359.32Molecular Weight (Monoisotopic): 359.0706AlogP: 2.35#Rotatable Bonds: ┄Polar Surface Area: 105.21Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.93CX Basic pKa: 1.51CX LogP: 1.47CX LogD: 1.47Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.75Np Likeness Score: -0.54
References 1. Bora D, Kaushal A, Shankaraiah N.. (2021) Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition., 215 [PMID:33601313 ] [10.1016/j.ejmech.2021.113263 ]