Peganumine A

ID: ALA5286527

Max Phase: Preclinical

Molecular Formula: C28H32N4O3

Molecular Weight: 472.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)NC1C2CCN2C(=O)[C@]34C5Nc6cc(OC)ccc6C5CCN3[C@]12C4(C)C

Standard InChI:  InChI=1S/C28H32N4O3/c1-26(2)27-23-19(17-7-5-15(34-3)13-21(17)29-23)10-12-32(27)28(26)24-20(9-11-31(28)25(27)33)18-8-6-16(35-4)14-22(18)30-24/h5-8,13-14,19-20,23-24,29-30H,9-12H2,1-4H3/t19?,20?,23?,24?,27-,28-/m0/s1

Standard InChI Key:  KRTJLDPTNHHICH-HOKZYCNASA-N

Molfile:  

 
     RDKit          2D

 35 42  0  0  0  0  0  0  0  0999 V2000
   -3.4022   -0.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4022   -1.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6888   -2.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9818   -1.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9818   -0.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6906   -0.5680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1810   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7121   -1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2021   -2.0447    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0892   -1.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4138   -0.5659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0539    0.0806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8522   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2266   -0.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3876   -1.4259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6879   -1.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6879   -2.6078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1314   -1.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7141   -1.1470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5531   -0.3812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8093   -0.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8093    0.6608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5492    0.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058    0.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7919    0.3275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1138    1.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6582    1.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8751    1.6055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0494    2.3585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6582    3.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0472   -1.8244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6315   -2.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0472   -2.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1138   -2.2144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1138   -3.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  9  8  1  0
  4  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 13  1  0
 11 14  1  0
 14 15  1  6
 16 15  1  0
 10 16  1  6
 16 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 14 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  2  0
 20 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 23 28  1  0
 27 29  1  0
 29 30  1  0
 14 31  1  0
 10 31  1  0
 31 32  1  0
 31 33  1  0
  2 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286527

    ---

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.59Molecular Weight (Monoisotopic): 472.2474AlogP: 3.59#Rotatable Bonds: 2
Polar Surface Area: 66.07Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.15CX LogP: 3.06CX LogD: 3.06
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.70Np Likeness Score: 0.56

References

1. Luo B, Song X..  (2021)  A comprehensive overview of β-carbolines and its derivatives as anticancer agents.,  224  [PMID:34332400] [10.1016/j.ejmech.2021.113688]

Source