methyl (S)-2-(4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)benzamido)-3-(3,4-dihydroxyphenyl)propanoate

ID: ALA5286548

Max Phase: Preclinical

Molecular Formula: C26H24N4O6S

Molecular Weight: 520.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)c1ccc(Sc2c(C)ccc3nc(N)[nH]c(=O)c23)cc1

Standard InChI:  InChI=1S/C26H24N4O6S/c1-13-3-9-17-21(24(34)30-26(27)29-17)22(13)37-16-7-5-15(6-8-16)23(33)28-18(25(35)36-2)11-14-4-10-19(31)20(32)12-14/h3-10,12,18,31-32H,11H2,1-2H3,(H,28,33)(H3,27,29,30,34)/t18-/m0/s1

Standard InChI Key:  COPVVTFPKPDAFX-SFHVURJKSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    3.2052   -1.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2052   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9168   -0.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6257   -1.0359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6257   -1.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9186   -2.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3371   -2.2685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3371   -0.6252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4938   -0.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7823   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7823   -1.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5068   -2.2761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0621   -2.2515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0621   -3.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0709   -0.6256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3595   -1.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3595   -1.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3519   -0.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0590   -1.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7724   -0.6293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7724    0.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4838    0.6064    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4838    1.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1970    1.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1970    2.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9144    3.0728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6257    2.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6257    1.8357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9093    1.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9093    0.6020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3371    3.0671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4856    3.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7769    2.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7769    1.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0655    1.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0608    0.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3519    0.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  5  7  1  0
  4  8  1  0
  9  2  1  0
 10  9  1  0
 10 11  1  1
 11 12  2  0
 11 13  1  0
 13 14  1  0
 15 10  1  0
 16 15  1  0
 16 17  2  0
 18 16  1  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 29 30  2  0
 27 31  1  0
 32 25  2  0
 33 32  1  0
 34 33  2  0
 23 34  1  0
 34 35  1  0
 36 21  2  0
 37 36  1  0
 18 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5286548

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.57Molecular Weight (Monoisotopic): 520.1417AlogP: 2.89#Rotatable Bonds: 7
Polar Surface Area: 167.63Molecular Species: NEUTRALHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.28CX Basic pKa: 3.40CX LogP: 3.52CX LogD: 3.51
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.18Np Likeness Score: -0.25

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source