The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(5-bromo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl)-2-(4-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethanone ID: ALA5286570
Max Phase: Preclinical
Molecular Formula: C23H27BrClN7O
Molecular Weight: 532.87
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(C(C(=O)N2CCN(c3ncnc4[nH]cc(Br)c34)CC2)c2ccc(Cl)cc2)CC1
Standard InChI: InChI=1S/C23H27BrClN7O/c1-29-6-8-30(9-7-29)20(16-2-4-17(25)5-3-16)23(33)32-12-10-31(11-13-32)22-19-18(24)14-26-21(19)27-15-28-22/h2-5,14-15,20H,6-13H2,1H3,(H,26,27,28)
Standard InChI Key: MECMVUIPPJEYFL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
0.7199 -3.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4345 -2.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1464 -3.1065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1464 -3.9316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4363 -4.3434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7199 -3.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0678 -2.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0678 -4.1913 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5548 -3.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2822 -2.0508 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1.4345 -1.8663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 -1.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 -0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4346 -0.2098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1518 -0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1518 -1.4522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4346 0.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 1.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1518 1.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7173 1.8608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 3.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7183 3.5151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4328 3.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4376 2.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7183 4.3434 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6184 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7172 -0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4345 -0.2098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4345 0.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7173 1.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1518 -0.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
6 8 1 0
8 9 1 0
9 7 2 0
7 10 1 0
11 2 1 0
11 12 1 0
13 12 1 0
14 13 1 0
15 14 1 0
11 16 1 0
16 15 1 0
14 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
23 26 1 0
27 18 1 0
27 28 1 0
29 28 1 0
30 29 1 0
31 30 1 0
27 32 1 0
32 31 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.87Molecular Weight (Monoisotopic): 531.1149AlogP: 3.01#Rotatable Bonds: 4Polar Surface Area: 71.60Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.14CX Basic pKa: 7.05CX LogP: 3.34CX LogD: 3.18Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.56Np Likeness Score: -1.41
References 1. Huang J, Chen L, Wu J, Ai D, Zhang JQ, Chen TG, Wang L.. (2022) Targeting the PI3K/AKT/mTOR Signaling Pathway in the Treatment of Human Diseases: Current Status, Trends, and Solutions., 65 (24.0): [PMID:36503229 ] [10.1021/acs.jmedchem.2c01070 ]