6'-amino-1-(2,4-dichlorobenzyl)-2'-(4,4-dimethyl-2,6-dioxocyclohexylidene)-2-oxospiro[indoline-3,4'-[1,3]dithiine]-5'-carbonitrile

ID: ALA5286579

Max Phase: Preclinical

Molecular Formula: C27H21Cl2N3O3S2

Molecular Weight: 570.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC(=O)C(=C2SC(N)=C(C#N)C3(S2)C(=O)N(Cc2ccc(Cl)cc2Cl)c2ccccc23)C(=O)C1

Standard InChI:  InChI=1S/C27H21Cl2N3O3S2/c1-26(2)10-20(33)22(21(34)11-26)24-36-23(31)17(12-30)27(37-24)16-5-3-4-6-19(16)32(25(27)35)13-14-7-8-15(28)9-18(14)29/h3-9H,10-11,13,31H2,1-2H3

Standard InChI Key:  SYNSMDRJEDWETG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    2.4097   -2.1032    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6018   -1.9361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0446   -2.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2089   -2.3818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3482   -2.9947    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.0418   -1.5739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5153   -0.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3510   -1.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8496   -1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1003   -0.6268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6268    0.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2089    0.0696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1003    0.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2646    0.7382    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.1253    1.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9611    1.5182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3789    0.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9889    0.0975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2147    0.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6326    1.6018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3290    2.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3569    1.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1868    2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3510    2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9054    2.9947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3203    2.1868    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1561    2.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6018    2.8833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5461    1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3818    1.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2195    1.4347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9082    0.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9082   -0.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6325   -0.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3569   -0.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3569    0.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6325    0.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  4  1  0
  7  6  2  0
  8  7  1  0
  2  8  2  0
  9  6  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 13 11  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 23 24  1  0
 24 16  1  0
 24 25  2  0
 15 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 13 29  1  0
 30 29  1  0
 30 31  3  0
 32 13  1  0
 33 32  2  0
 33 10  1  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286579

    ---

Associated Targets(non-human)

Proteus mirabilis (3894 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus epidermidis (22802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 570.52Molecular Weight (Monoisotopic): 569.0401AlogP: 6.08#Rotatable Bonds: 2
Polar Surface Area: 104.26Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.90CX LogD: 5.90
Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -0.89

References

1. Brandão P, Marques C, Burke AJ, Pineiro M..  (2021)  The application of isatin-based multicomponent-reactions in the quest for new bioactive and druglike molecules.,  211  [PMID:33421712] [10.1016/j.ejmech.2020.113102]

Source