The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6'-amino-1-(2,4-dichlorobenzyl)-2'-(4,4-dimethyl-2,6-dioxocyclohexylidene)-2-oxospiro[indoline-3,4'-[1,3]dithiine]-5'-carbonitrile ID: ALA5286579
Max Phase: Preclinical
Molecular Formula: C27H21Cl2N3O3S2
Molecular Weight: 570.52
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC(=O)C(=C2SC(N)=C(C#N)C3(S2)C(=O)N(Cc2ccc(Cl)cc2Cl)c2ccccc23)C(=O)C1
Standard InChI: InChI=1S/C27H21Cl2N3O3S2/c1-26(2)10-20(33)22(21(34)11-26)24-36-23(31)17(12-30)27(37-24)16-5-3-4-6-19(16)32(25(27)35)13-14-7-8-15(28)9-18(14)29/h3-9H,10-11,13,31H2,1-2H3
Standard InChI Key: SYNSMDRJEDWETG-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
2.4097 -2.1032 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6018 -1.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0446 -2.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2089 -2.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3482 -2.9947 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0418 -1.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5153 -0.9610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3510 -1.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8496 -1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1003 -0.6268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6268 0.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2089 0.0696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1003 0.7382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2646 0.7382 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.1253 1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9611 1.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3789 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9889 0.0975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2147 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6326 1.6018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3290 2.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3569 1.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1868 2.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3510 2.2704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9054 2.9947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3203 2.1868 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1561 2.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6018 2.8833 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5461 1.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3818 1.4347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2195 1.4347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9082 0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9082 -0.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6325 -0.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3569 -0.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3569 0.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6325 0.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
4 5 1 0
6 4 1 0
7 6 2 0
8 7 1 0
2 8 2 0
9 6 1 0
9 10 1 0
10 11 1 0
11 12 2 0
13 11 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
23 24 1 0
24 16 1 0
24 25 2 0
15 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
13 29 1 0
30 29 1 0
30 31 3 0
32 13 1 0
33 32 2 0
33 10 1 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
32 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 570.52Molecular Weight (Monoisotopic): 569.0401AlogP: 6.08#Rotatable Bonds: 2Polar Surface Area: 104.26Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.90CX LogD: 5.90Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.34Np Likeness Score: -0.89
References 1. Brandão P, Marques C, Burke AJ, Pineiro M.. (2021) The application of isatin-based multicomponent-reactions in the quest for new bioactive and druglike molecules., 211 [PMID:33421712 ] [10.1016/j.ejmech.2020.113102 ]