The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-3-hydroxy-N-(3-(5-methyl-4-(pyridin-4-yl)-6-(tetrahydro-2H-pyran-4-ylamino)pyrimidin-2-yl)benzyl)propanamide ID: ALA5286582
Max Phase: Preclinical
Molecular Formula: C25H30N6O3
Molecular Weight: 462.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(NC2CCOCC2)nc(-c2cccc(CNC(=O)[C@@H](N)CO)c2)nc1-c1ccncc1
Standard InChI: InChI=1S/C25H30N6O3/c1-16-22(18-5-9-27-10-6-18)30-24(31-23(16)29-20-7-11-34-12-8-20)19-4-2-3-17(13-19)14-28-25(33)21(26)15-32/h2-6,9-10,13,20-21,32H,7-8,11-12,14-15,26H2,1H3,(H,28,33)(H,29,30,31)/t21-/m0/s1
Standard InChI Key: LORGBJZTEDYKIJ-NRFANRHFSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
39.2042 -13.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2030 -14.1778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9159 -14.5896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6303 -14.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6274 -13.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9141 -12.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4917 -12.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7793 -13.3531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3384 -12.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0496 -13.3469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7600 -12.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7573 -12.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0383 -11.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3308 -12.1172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.4677 -11.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0323 -10.8788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3169 -10.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3135 -9.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6022 -9.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8902 -9.6552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.8942 -10.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6102 -10.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4713 -13.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4727 -14.1641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1857 -14.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8977 -14.1593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.8924 -13.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1788 -12.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0668 -12.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3544 -13.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0666 -12.1193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6418 -12.9423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3546 -14.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0671 -14.5874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
11 23 1 0
8 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
30 33 1 6
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.55Molecular Weight (Monoisotopic): 462.2379AlogP: 2.04#Rotatable Bonds: 8Polar Surface Area: 135.28Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.96CX Basic pKa: 7.85CX LogP: 1.39CX LogD: 0.81Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.85
References 1. Zhang Z, Guo Z, Xu X, Cao D, Yang H, Li Y, Shi Q, Du Z, Guo X, Wang X, Chen D, Zhang Y, Chen L, Zhou K, Li J, Geng M, Huang X, Xiong B.. (2021) Structure-Based Discovery of Potent CARM1 Inhibitors for Solid Tumor and Cancer Immunology Therapy., 64 (22.0): [PMID:34781683 ] [10.1021/acs.jmedchem.1c01308 ]