The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
26-amino-55-fluoro-11,7-dimethyl-6-oxo-11H-3-oxa-7-aza-2(3,5)-pyridina-1(4,3)-pyrazola-5(1,2)-benzenacyclooctaphane-15-carbonitrile ID: ALA5286590
Max Phase: Preclinical
Molecular Formula: C20H17FN6O2
Molecular Weight: 392.39
Associated Items:
Names and Identifiers Canonical SMILES: CN1Cc2nn(C)c(C#N)c2-c2cnc(N)c(c2)OCc2cc(F)ccc2C1=O
Standard InChI: InChI=1S/C20H17FN6O2/c1-26-9-15-18(16(7-22)27(2)25-15)11-6-17(19(23)24-8-11)29-10-12-5-13(21)3-4-14(12)20(26)28/h3-6,8H,9-10H2,1-2H3,(H2,23,24)
Standard InChI Key: HZCMQKCVEKESHL-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-1.0556 0.8603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5969 0.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3533 -0.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0029 -1.0072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6796 -0.5200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4089 0.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8962 0.9145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3707 1.5734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4375 -0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5683 -0.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4059 -1.4944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3248 -1.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0827 -1.5215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2721 -0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0571 -0.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6526 -1.1155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4361 -1.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6511 -2.0899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -0.8989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.8120 -0.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3248 -2.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0285 -1.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3197 1.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7877 2.2392 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0097 2.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2742 1.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2548 0.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5841 2.6583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0588 1.1100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 2 2 0
7 6 1 0
7 8 3 0
5 9 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
14 20 1 0
12 21 2 0
11 22 1 0
23 1 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
1 27 1 0
25 28 1 0
26 29 1 0
20 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.39Molecular Weight (Monoisotopic): 392.1397AlogP: 2.24#Rotatable Bonds: ┄Polar Surface Area: 110.06Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.72CX LogP: 1.21CX LogD: 1.20Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: -0.68