N-hydroxy-3-(4-(N-(2-(trifluoromethyl)phenyl)sulfamoyl)phenyl)acrylamide

ID: ALA5286621

Max Phase: Preclinical

Molecular Formula: C16H13F3N2O4S

Molecular Weight: 386.35

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccc(S(=O)(=O)Nc2ccccc2C(F)(F)F)cc1)NO

Standard InChI:  InChI=1S/C16H13F3N2O4S/c17-16(18,19)13-3-1-2-4-14(13)21-26(24,25)12-8-5-11(6-9-12)7-10-15(22)20-23/h1-10,21,23H,(H,20,22)/b10-7+

Standard InChI Key:  JYGJTUUVSSOBLG-JXMROGBWSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   -4.2857   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8592   -0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8592   -1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5693   -1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2857   -1.4471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1446   -0.2056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4300   -0.6182    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7153    0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125    0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125   -0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0023   -0.6200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1418    0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5711    0.6175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8564    1.8553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2857    1.0301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8433   -1.3342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0182   -1.3342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2857    1.0314    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8565    1.0314    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5711    1.4439    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
  8 21  2  0
  8 22  2  0
  2 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286621

    ---

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.35Molecular Weight (Monoisotopic): 386.0548AlogP: 3.02#Rotatable Bonds: 5
Polar Surface Area: 95.50Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 7.28CX Basic pKa: CX LogP: 2.69CX LogD: 2.39
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.42Np Likeness Score: -1.18

References

1. Liu W, Liang Y, Si X..  (2020)  Hydroxamic acid hybrids as the potential anticancer agents: An Overview.,  205  [PMID:32791404] [10.1016/j.ejmech.2020.112679]

Source