The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isomasticadienolic acid ID: ALA5286625
Max Phase: Preclinical
Molecular Formula: C30H48O3
Molecular Weight: 456.71
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C/C(=C/CC[C@H](C)[C@@H]1CC[C@]2(C)C3=C(CC[C@@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3)C(=O)O
Standard InChI: InChI=1S/C30H48O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h10,19,21,24-25,31H,8-9,11-18H2,1-7H3,(H,32,33)/b20-10-/t19-,21-,24-,25-,28+,29-,30+/m0/s1
Standard InChI Key: KGELVXQPIUKGCO-KXQRDGDESA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
1.4608 1.1825 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.6496 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8631 1.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6600 2.0427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2433 1.4593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0402 1.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6236 1.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4101 0.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6132 0.0790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9934 -0.2907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4204 1.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2798 2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1343 0.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6495 -0.3021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1347 -0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0485 -0.8677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8490 -0.4596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8490 -1.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5633 -1.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2775 -1.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9918 -1.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5800 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4050 -2.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7060 -1.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4204 -1.6968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7060 -0.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9918 -0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2775 -0.4595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2775 0.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5633 -0.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5633 0.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8489 1.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1347 0.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0484 1.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2775 -2.1093 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
8 10 1 0
7 11 1 0
3 12 1 1
2 13 1 0
13 14 1 0
15 14 1 0
15 16 1 1
17 15 1 0
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
21 22 1 0
21 23 1 0
24 21 1 0
24 25 1 1
26 24 1 0
26 27 1 0
28 27 1 0
20 28 1 0
28 29 1 1
28 30 1 0
17 30 2 0
30 31 1 0
32 31 1 0
33 32 1 0
33 2 1 0
15 33 1 0
33 34 1 6
20 35 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.71Molecular Weight (Monoisotopic): 456.3603AlogP: 7.54#Rotatable Bonds: 5Polar Surface Area: 57.53Molecular Species: ACIDHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.62CX Basic pKa: ┄CX LogP: 6.90CX LogD: 4.19Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 3.38
References 1. Ghobadi E, Ghanbarimasir Z, Emami S.. (2021) A review on the structures and biological activities of anti-Helicobacter pylori agents., 223 [PMID:34218084 ] [10.1016/j.ejmech.2021.113669 ]