1-(3-((4-amino-6-((3-chloro-4-methylphenyl)amino)-1,3,5-triazin-2-yl)methoxy)-5-(trifluoromethyl)phenyl)pyrrolidin-2-one

ID: ALA5286632

Max Phase: Preclinical

Molecular Formula: C22H20ClF3N6O2

Molecular Weight: 492.89

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(Nc2nc(N)nc(COc3cc(N4CCCC4=O)cc(C(F)(F)F)c3)n2)cc1Cl

Standard InChI:  InChI=1S/C22H20ClF3N6O2/c1-12-4-5-14(9-17(12)23)28-21-30-18(29-20(27)31-21)11-34-16-8-13(22(24,25)26)7-15(10-16)32-6-2-3-19(32)33/h4-5,7-10H,2-3,6,11H2,1H3,(H3,27,28,29,30,31)

Standard InChI Key:  IYTHMFHSOULRPV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -4.5947   -0.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8801   -0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1682   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1682   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8783   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5947   -1.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3093   -1.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4536   -0.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7389   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0241   -0.2061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3120   -0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3120   -1.4436    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0223   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7389   -1.4473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0223   -2.6807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4025   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1172   -0.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8318   -0.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8320    0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5449    1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2597    0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2613   -0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5495   -0.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9759   -0.6161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6906   -0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3093   -0.7748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9786   -1.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1545   -1.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5710   -2.0005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3093   -0.2063    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5449    1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8303    2.2680    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2595    2.2680    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5449    2.6807    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  3  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 13 15  1  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 18 23  1  0
 24 22  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 27  1  0
 24 28  1  0
 28 29  2  0
  1 30  1  0
 20 31  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286632

    ---

Associated Targets(Human)

FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.89Molecular Weight (Monoisotopic): 492.1288AlogP: 4.88#Rotatable Bonds: 6
Polar Surface Area: 106.26Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.66CX Basic pKa: 4.10CX LogP: 4.86CX LogD: 4.86
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -2.02

References

1. Lückmann M, Shenol A, Nissen TAD, Petersen JE, Kouvchinov D, Schwartz TW, Frimurer TM..  (2022)  Optimization of First-in-Class Dual-Acting FFAR1/FFAR4 Allosteric Modulators with Novel Mode of Action.,  13  (12.0): [PMID:36518697] [10.1021/acsmedchemlett.2c00160]

Source