2-((9,10-dihydroacridin-9-yl)methylene)-3-(diphenylamino)thiazolidin-4-one

ID: ALA5286648

Max Phase: Preclinical

Molecular Formula: C29H23N3OS

Molecular Weight: 461.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CS/C(=C\C2c3ccccc3Nc3ccccc32)N1N(c1ccccc1)c1ccccc1

Standard InChI:  InChI=1S/C29H23N3OS/c33-28-20-34-29(32(28)31(21-11-3-1-4-12-21)22-13-5-2-6-14-22)19-25-23-15-7-9-17-26(23)30-27-18-10-8-16-24(25)27/h1-19,25,30H,20H2/b29-19-

Standard InChI Key:  NBFSHLCBLKEHCB-CEUNXORHSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -2.1410   -2.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263   -1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -2.8862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4246   -3.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1410   -2.8899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.2989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -2.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -2.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7147    0.4144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5188    0.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9896    0.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4976   -0.6566    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7324    1.4616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8270    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    0.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7147   -0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4276   -0.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -0.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1441    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4321    0.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.6522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7137    2.8877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0011    3.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7129    2.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7178    2.0665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4274   -1.6502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1422   -2.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1441   -2.8838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4324   -3.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 12 16  1  0
 14 17  2  0
 13 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 18 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
  9 31  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
  8 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286648

    ---

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.59Molecular Weight (Monoisotopic): 461.1562AlogP: 7.05#Rotatable Bonds: 4
Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.34CX LogD: 6.34
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.35

References

1. Bora D, Kaushal A, Shankaraiah N..  (2021)  Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition.,  215  [PMID:33601313] [10.1016/j.ejmech.2021.113263]

Source