The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((9,10-dihydroacridin-9-yl)methylene)-3-(diphenylamino)thiazolidin-4-one ID: ALA5286648
Max Phase: Preclinical
Molecular Formula: C29H23N3OS
Molecular Weight: 461.59
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CS/C(=C\C2c3ccccc3Nc3ccccc32)N1N(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C29H23N3OS/c33-28-20-34-29(32(28)31(21-11-3-1-4-12-21)22-13-5-2-6-14-22)19-25-23-15-7-9-17-26(23)30-27-18-10-8-16-24(25)27/h1-19,25,30H,20H2/b29-19-
Standard InChI Key: NBFSHLCBLKEHCB-CEUNXORHSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
-2.1410 -2.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4263 -1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 -2.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4246 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1410 -2.8899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.2989 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -2.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -2.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 0.4144 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5188 0.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9896 0.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4976 -0.6566 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7324 1.4616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.8270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4276 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 -0.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1441 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4321 0.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 2.0650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7137 2.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0011 3.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7129 2.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7178 2.0665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4274 -1.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1422 -2.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 -2.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4324 -3.3004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
3 10 1 0
10 11 1 0
11 12 2 0
13 12 1 0
13 14 1 0
14 15 1 0
16 15 1 0
12 16 1 0
14 17 2 0
13 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
18 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
9 31 1 0
32 31 2 0
33 32 1 0
34 33 2 0
8 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.59Molecular Weight (Monoisotopic): 461.1562AlogP: 7.05#Rotatable Bonds: 4Polar Surface Area: 35.58Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.34CX LogD: 6.34Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.35
References 1. Bora D, Kaushal A, Shankaraiah N.. (2021) Anticancer potential of spirocompounds in medicinal chemistry: A pentennial expedition., 215 [PMID:33601313 ] [10.1016/j.ejmech.2021.113263 ]