The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-chlorophenyl)-2-(2-(4-((7-chloroquinolin-4-yl)oxy)-3-methoxybenzylidene)hydrazinyl)thiazole ID: ALA5286667
Max Phase: Preclinical
Molecular Formula: C26H18Cl2N4O2S
Molecular Weight: 521.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/Nc2nc(-c3ccc(Cl)cc3)cs2)ccc1Oc1ccnc2cc(Cl)ccc12
Standard InChI: InChI=1S/C26H18Cl2N4O2S/c1-33-25-12-16(14-30-32-26-31-22(15-35-26)17-3-5-18(27)6-4-17)2-9-24(25)34-23-10-11-29-21-13-19(28)7-8-20(21)23/h2-15H,1H3,(H,31,32)/b30-14+
Standard InChI Key: BGBBBAIVEDCJAV-AMVVHIIESA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
2.2921 -0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2921 -1.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0054 -2.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7126 -1.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7126 -0.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0037 -0.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4242 -0.3965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4242 0.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7134 0.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7134 1.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4252 2.0664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1388 1.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1388 0.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0012 2.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2943 1.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2943 0.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0047 0.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5827 2.0651 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.4242 -2.0399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1358 -1.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5805 -2.0436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8689 -1.6327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1573 -2.0436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5542 -1.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3045 -1.9668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8541 -1.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4435 -0.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6401 -0.8159 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.6758 -1.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0884 -0.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9097 -0.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3171 -1.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9061 -2.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0869 -2.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1388 -1.3554 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
9 17 1 0
15 18 1 0
4 19 1 0
19 20 1 0
2 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
25 24 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
29 26 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 29 2 0
32 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.43Molecular Weight (Monoisotopic): 520.0528AlogP: 7.91#Rotatable Bonds: 7Polar Surface Area: 68.63Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.76CX Basic pKa: 4.98CX LogP: 7.89CX LogD: 7.87Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.17Np Likeness Score: -1.40