5,5'-diallyl-3-((dibutylamino)methyl)-[1,1'-biphenyl]-2,2'-diol

ID: ALA5286697

Max Phase: Preclinical

Molecular Formula: C27H37NO2

Molecular Weight: 407.60

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCc1ccc(O)c(-c2cc(CC=C)cc(CN(CCCC)CCCC)c2O)c1

Standard InChI:  InChI=1S/C27H37NO2/c1-5-9-15-28(16-10-6-2)20-23-17-22(12-8-4)19-25(27(23)30)24-18-21(11-7-3)13-14-26(24)29/h7-8,13-14,17-19,29-30H,3-6,9-12,15-16,20H2,1-2H3

Standard InChI Key:  WRVXZNBHBVCNKB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   -1.4266   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7120   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -1.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7102   -2.0600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4266   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -2.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292   -1.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -2.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1413   -2.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4310   -3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -2.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002   -3.3021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8559   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5706   -2.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2852   -1.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.4105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413   -2.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5705   -2.0645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7120    0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267    0.8265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267    1.6518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413    0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413    2.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1413    2.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559    0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5706    0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8559    3.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2852    0.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  4  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
 12 13  1  0
  9 14  1  0
 14 15  1  0
 15 16  2  0
  3 17  1  0
  6 18  1  0
 18 19  1  0
 19 20  2  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 23 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 26 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286697

    ---

Associated Targets(Human)

MGAM Tclin Maltase-glucoamylase (654 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.60Molecular Weight (Monoisotopic): 407.2824AlogP: 6.62#Rotatable Bonds: 13
Polar Surface Area: 43.70Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.43CX Basic pKa: 11.09CX LogP: 6.41CX LogD: 6.12
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: 0.28

References

1. Chu J, Yang R, Cheng W, Cui L, Pan H, Liu J, Guo Y..  (2022)  Semisynthesis, biological activities, and mechanism studies of Mannich base analogues of magnolol/honokiol as potential α-glucosidase inhibitors.,  75  [PMID:36327695] [10.1016/j.bmc.2022.117070]

Source