The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-methoxy-5-((2-(2-nitrophenyl)ethylidene)amino)-N4-phenylpyrimidine-2,4-diamine ID: ALA5286699
Max Phase: Preclinical
Molecular Formula: C19H18N6O3
Molecular Weight: 378.39
Associated Items:
Names and Identifiers Canonical SMILES: COc1nc(N)nc(Nc2ccccc2)c1/N=C/Cc1ccccc1[N+](=O)[O-]
Standard InChI: InChI=1S/C19H18N6O3/c1-28-18-16(21-12-11-13-7-5-6-10-15(13)25(26)27)17(23-19(20)24-18)22-14-8-3-2-4-9-14/h2-10,12H,11H2,1H3,(H3,20,22,23,24)/b21-12+
Standard InChI Key: NHTIBVCQAJAWAI-CIAFOILYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-2.4998 0.2060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7852 0.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0734 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0734 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7835 -1.0306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4998 -0.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7852 1.4435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4998 1.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2145 -1.0350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 -1.0313 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 -1.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 0.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0704 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2120 0.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2120 -0.6185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5017 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 -0.6222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 1.4440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2145 1.8565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7852 1.8565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0731 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0731 -3.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 -3.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3557 -3.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3557 -2.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
7 8 1 0
6 9 1 0
4 10 1 0
10 11 1 0
3 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
21 16 1 0
21 22 1 0
21 23 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
11 24 2 0
28 11 1 0
M CHG 2 21 1 22 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.39Molecular Weight (Monoisotopic): 378.1440AlogP: 3.66#Rotatable Bonds: 7Polar Surface Area: 128.56Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.11CX Basic pKa: 5.90CX LogP: 3.95CX LogD: 3.94Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -0.99
References 1. Rojas S, Parravicini O, Vettorazzi M, Tosso R, Garro A, Gutiérrez L, Andújar S, Enriz R.. (2020) Combined MD/QTAIM techniques to evaluate ligand-receptor interactions. Scope and limitations., 208 [PMID:32949964 ] [10.1016/j.ejmech.2020.112792 ]