2-((6-chloropyridazin-3-yl)amino)-5-phenylnicotinonitrile

ID: ALA5286765

Max Phase: Preclinical

Molecular Formula: C16H10ClN5

Molecular Weight: 307.74

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cc(-c2ccccc2)cnc1Nc1ccc(Cl)nn1

Standard InChI:  InChI=1S/C16H10ClN5/c17-14-6-7-15(22-21-14)20-16-12(9-18)8-13(10-19-16)11-4-2-1-3-5-11/h1-8,10H,(H,19,20,22)

Standard InChI Key:  KUNTUXACFBFEOT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -0.3435    0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3710   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3435   -0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3435   -1.4431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3710   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0857   -1.4431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0857   -0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8005   -0.1786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7730    0.6459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4877    1.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4877    1.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7730    2.2952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0582    1.8554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0582    1.0307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7454    3.1200    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0582   -1.8555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7730   -1.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4877   -1.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4603   -2.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7454   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0307   -2.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3160    1.4426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 12 15  1  0
  4 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
  1 22  3  0
M  END

Alternative Forms

  1. Parent:

    ALA5286765

    ---

Associated Targets(Human)

NFE2L2 Tchem Nuclear factor erythroid 2-related factor 2 (95332 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.74Molecular Weight (Monoisotopic): 307.0625AlogP: 3.81#Rotatable Bonds: 3
Polar Surface Area: 74.49Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.98CX Basic pKa: CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.80Np Likeness Score: -1.81

References

1. Hou Z, Lockwood L, Zhang D, Occhiuto CJ, Mo L, Aldrich KE, Stoub HE, Gallo KA, Liby KT, Odom AL..  (2023)  Exploring structural effects in a new class of NRF2 inhibitors.,  14  (1.0): [PMID:36760735] [10.1039/d2md00211f]

Source