N-(3-((4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl)methyl)-4-oxo-3,4-dihydroquinazolin-7-yl)-3-(piperidin-1-yl)propanamide

ID: ALA5286779

Max Phase: Preclinical

Molecular Formula: C32H41N5O4

Molecular Weight: 559.71

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CC(=O)N1CCC(O)(Cn2cnc3cc(NC(=O)CCN4CCCCC4)ccc3c2=O)CC1)c1ccccc1

Standard InChI:  InChI=1S/C32H41N5O4/c1-24(25-8-4-2-5-9-25)20-30(39)36-18-13-32(41,14-19-36)22-37-23-33-28-21-26(10-11-27(28)31(37)40)34-29(38)12-17-35-15-6-3-7-16-35/h2,4-5,8-11,21,23-24,41H,3,6-7,12-20,22H2,1H3,(H,34,38)

Standard InChI Key:  KEFUSYLFCNBJLJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   -6.7850   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0704   -0.6197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0704   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7849   -1.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4993   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4993   -0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3561   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6417   -0.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9272    0.6177    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2128   -0.6196    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7822   -0.6151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0723   -0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547   -0.6175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3548   -0.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3548    0.6198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3598    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0723    0.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7840    1.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4984    0.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3598    1.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0693    1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126   -0.2051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2126    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4981    1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9269   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6414   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3558   -0.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3558   -1.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0702   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7878   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4993   -0.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4993    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7831    1.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0702    0.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9269   -1.4424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7837    1.4447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  7  2  1  0
  8  7  1  0
  9  8  1  0
  9 10  2  0
 11  9  1  0
 12 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 19 18  1  0
 14 19  2  0
 19 20  1  0
 20 21  2  0
 21 12  1  0
 18 22  2  0
 17 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 34  2  0
 30 40  2  0
 24 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286779

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 559.71Molecular Weight (Monoisotopic): 559.3159AlogP: 3.76#Rotatable Bonds: 9
Polar Surface Area: 107.77Molecular Species: BASEHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: 9.21CX LogP: 2.22CX LogD: 0.41
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.41Np Likeness Score: -1.24

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source