N-(6-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridin-2-yl)-6-(1-hydroxy-2-methylpropan-2-yl)nicotinamide

ID: ALA5286791

Max Phase: Preclinical

Molecular Formula: C20H20N6O2

Molecular Weight: 376.42

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(CO)c1ccc(C(=O)Nc2cn3cc(-c4cn[nH]c4)ccc3n2)cn1

Standard InChI:  InChI=1S/C20H20N6O2/c1-20(2,12-27)16-5-3-13(7-21-16)19(28)25-17-11-26-10-14(4-6-18(26)24-17)15-8-22-23-9-15/h3-11,27H,12H2,1-2H3,(H,22,23)(H,25,28)

Standard InChI Key:  GWFMLYGNGYNZGY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   21.9032  -11.3416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9073  -12.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6130  -11.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7434  -13.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4525  -13.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4486  -12.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7384  -12.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1577  -12.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1594  -13.2898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9390  -13.5414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4192  -12.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9363  -12.2159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2364  -12.8759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6435  -12.1674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4607  -12.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2335  -11.4605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8668  -12.8729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6833  -12.8716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0912  -12.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6768  -11.4533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8617  -11.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3194  -12.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0375  -13.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2897  -13.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7452  -13.9799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1565  -14.6861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9551  -14.5131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1366  -12.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  4  7  1  0
  5  9  1  0
  8  6  1  0
  6  7  2  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 15  1  0
 19  2  1  0
  2 22  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 23  2  0
  4 23  1  0
 22 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286791

    ---

Associated Targets(Human)

CLK1 Tchem Dual specificty protein kinase CLK1 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CLK2 Tchem Dual specificity protein kinase CLK2 (3942 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.42Molecular Weight (Monoisotopic): 376.1648AlogP: 2.64#Rotatable Bonds: 5
Polar Surface Area: 108.20Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.99CX Basic pKa: 3.52CX LogP: 1.83CX LogD: 1.83
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -1.68

References

1. Qin Z, Qin L, Feng X, Li Z, Bian J..  (2021)  Development of Cdc2-like Kinase 2 Inhibitors: Achievements and Future Directions.,  64  (18.0): [PMID:34519506] [10.1021/acs.jmedchem.1c00985]

Source