1-(3-(3,5-difluorophenyl)-6-(3-fluorophenyl)quinolin-4-yl)piperidin-4-amine

ID: ALA5286792

Max Phase: Preclinical

Molecular Formula: C26H22F3N3

Molecular Weight: 433.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC1CCN(c2c(-c3cc(F)cc(F)c3)cnc3ccc(-c4cccc(F)c4)cc23)CC1

Standard InChI:  InChI=1S/C26H22F3N3/c27-19-3-1-2-16(10-19)17-4-5-25-23(13-17)26(32-8-6-22(30)7-9-32)24(15-31-25)18-11-20(28)14-21(29)12-18/h1-5,10-15,22H,6-9,30H2

Standard InChI Key:  WTSLYGWSJGGKHF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -0.3540    1.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3540    0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604    0.0017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0749    0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0749    1.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604    1.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604    2.4767    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3604   -0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3542   -1.2356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3542   -2.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3622   -2.4723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0723   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0723   -1.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7869   -0.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7871    0.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    1.2379    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.2145    0.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2161   -0.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5045   -1.2370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306   -1.2331    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0698   -2.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7877   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7895   -1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0749   -0.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5040   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2186   -1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -0.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -0.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2204    0.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5040    0.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2204    1.2360    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  1  1  0
  6  7  1  0
  3  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 14 13  1  0
 15 14  2  0
 16 15  1  0
 16 17  1  0
 18 16  2  0
 19 18  1  0
 20 19  2  0
 14 20  1  0
 19 21  1  0
 10 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
  9 25  1  0
 26 24  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 26 31  1  0
 31 30  2  0
 30 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286792

    ---

Associated Targets(Human)

SSTR2 Tclin Somatostatin receptor 2 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 433.48Molecular Weight (Monoisotopic): 433.1766AlogP: 5.91#Rotatable Bonds: 3
Polar Surface Area: 42.15Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.03CX LogP: 5.17CX LogD: 2.31
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -0.89

References

1. Zhao J, Wang S, Markison S, Kim SH, Han S, Chen M, Kusnetzow AK, Rico-Bautista E, Johns M, Luo R, Struthers RS, Madan A, Zhu Y, Betz SF..  (2023)  Discovery of Paltusotine (CRN00808), a Potent, Selective, and Orally Bioavailable Non-peptide SST2 Agonist.,  14  (1.0): [PMID:36655128] [10.1021/acsmedchemlett.2c00431]

Source