4-(((2Z,5Z)-5-((E)-3-(4-(dimethylamino)phenyl)allylidene)-4-oxo-2-(phenylimino)thiazolidin-3-yl)methyl)benzoic acid

ID: ALA5286820

Max Phase: Preclinical

Molecular Formula: C28H25N3O3S

Molecular Weight: 483.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc(/C=C/C=C2\S/C(=N\c3ccccc3)N(Cc3ccc(C(=O)O)cc3)C2=O)cc1

Standard InChI:  InChI=1S/C28H25N3O3S/c1-30(2)24-17-13-20(14-18-24)7-6-10-25-26(32)31(19-21-11-15-22(16-12-21)27(33)34)28(35-25)29-23-8-4-3-5-9-23/h3-18H,19H2,1-2H3,(H,33,34)/b7-6+,25-10-,29-28-

Standard InChI Key:  CDSVYHLVHOHWFP-AIMXQVSHSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.2814   -0.1084    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.1064   -0.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3661    0.6758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6959    1.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0302    0.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6947    1.9891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5922   -0.7730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7546    0.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1512    0.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7604    0.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1749   -1.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3494   -1.4789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0635   -2.1915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3441   -2.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1734   -2.9094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5868   -2.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5863   -0.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1989   -0.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9851   -0.7240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1551    0.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5412    0.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6010   -1.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4261   -2.0872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3858   -1.0265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3685    0.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1534    0.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7632    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5447    0.3408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1583   -0.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9875   -1.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1977   -1.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5875   -0.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6006   -1.5702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3858   -1.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4244   -2.3769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  2  0
  2  7  2  0
  5  8  2  0
  3  9  1  0
  9 10  1  0
  7 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 10  1  0
 19 22  1  0
 22 23  1  0
 22 24  2  0
  8 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286820

    ---

Associated Targets(Human)

PPARA Tclin Peroxisome proliferator-activated receptor alpha (9197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.59Molecular Weight (Monoisotopic): 483.1617AlogP: 5.81#Rotatable Bonds: 7
Polar Surface Area: 73.21Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.05CX Basic pKa: 4.90CX LogP: 4.96CX LogD: 3.04
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.13

References

1. Kaminskyy D, Kryshchyshyn A, Lesyk R..  (2017)  5-Ene-4-thiazolidinones - An efficient tool in medicinal chemistry.,  140  [PMID:28987611] [10.1016/j.ejmech.2017.09.031]

Source