N-(6'-amino-4'-ethyl-5'-(4-hydroxyphenyl)-[3,3'-bipyridin]-6-yl)acetamide

ID: ALA5286847

Max Phase: Preclinical

Molecular Formula: C20H20N4O2

Molecular Weight: 348.41

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1c(-c2ccc(NC(C)=O)nc2)cnc(N)c1-c1ccc(O)cc1

Standard InChI:  InChI=1S/C20H20N4O2/c1-3-16-17(14-6-9-18(22-10-14)24-12(2)25)11-23-20(21)19(16)13-4-7-15(26)8-5-13/h4-11,26H,3H2,1-2H3,(H2,21,23)(H,22,24,25)

Standard InChI Key:  JXOOSGBMNNXLEQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    2.1452    1.4468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4311    1.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4311    0.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1467   -0.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1467   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8643   -1.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5756   -1.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2912   -1.4409    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5756   -0.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8625    0.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7183   -0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7183   -1.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4340   -1.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    0.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0002    1.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7137    1.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7159   -0.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7159   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4270   -1.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1443   -1.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8598   -1.4470    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5756   -1.0338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2912   -1.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5756   -0.2075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1443   -0.2042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4288    0.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10  4  2  0
 11  3  2  0
 11 12  1  0
 12 13  1  0
 14 11  1  0
 15 14  2  0
 16 15  1  0
  2 16  2  0
 14 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 25 20  1  0
 26 25  2  0
 17 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286847

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.41Molecular Weight (Monoisotopic): 348.1586AlogP: 3.62#Rotatable Bonds: 4
Polar Surface Area: 101.13Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.76CX Basic pKa: 6.78CX LogP: 3.08CX LogD: 2.99
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.32

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source