Pegaharmaline B

ID: ALA5286857

Max Phase: Preclinical

Molecular Formula: C24H18N4O2

Molecular Weight: 394.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c([nH]c2c1)-c1c(C(=O)c2ncc4ccccc4n2)ccn1CC3

Standard InChI:  InChI=1S/C24H18N4O2/c1-30-15-6-7-16-17-8-10-28-11-9-18(22(28)21(17)26-20(16)12-15)23(29)24-25-13-14-4-2-3-5-19(14)27-24/h2-7,9,11-13,26H,8,10H2,1H3

Standard InChI Key:  YKMNHMZVBHFZEZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 35  0  0  0  0  0  0  0  0999 V2000
   -4.2075   -0.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2075   -0.1095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4911    0.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4911    1.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7747    1.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0609    1.1351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546    1.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9237    2.1198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1199    2.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3510    1.5502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0241    0.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7827    0.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2760    0.0612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0609    0.3077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7728   -0.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6270    0.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3314    0.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1693    1.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6270   -0.5451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3434   -0.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0600   -0.5452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7740   -0.9583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7740   -1.7859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0619   -2.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3434   -1.7896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4938   -2.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2075   -1.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2075   -0.9599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4888   -0.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0894   -0.9587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  7 12  2  0
 13 12  1  0
 14 13  1  0
 14  6  2  0
 15 14  1  0
  3 15  2  0
 11 16  2  0
 16 17  1  0
 18 17  2  0
 10 18  1  0
 16 19  1  0
 19 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 20 25  1  0
 23 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 22 29  1  0
 19 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5286857

    ---

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.43Molecular Weight (Monoisotopic): 394.1430AlogP: 4.38#Rotatable Bonds: 3
Polar Surface Area: 72.80Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.07CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -0.31

References

1. Luo B, Song X..  (2021)  A comprehensive overview of β-carbolines and its derivatives as anticancer agents.,  224  [PMID:34332400] [10.1016/j.ejmech.2021.113688]

Source