The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pegaharmaline B ID: ALA5286857
Max Phase: Preclinical
Molecular Formula: C24H18N4O2
Molecular Weight: 394.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c3c([nH]c2c1)-c1c(C(=O)c2ncc4ccccc4n2)ccn1CC3
Standard InChI: InChI=1S/C24H18N4O2/c1-30-15-6-7-16-17-8-10-28-11-9-18(22(28)21(17)26-20(16)12-15)23(29)24-25-13-14-4-2-3-5-19(14)27-24/h2-7,9,11-13,26H,8,10H2,1H3
Standard InChI Key: YKMNHMZVBHFZEZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 35 0 0 0 0 0 0 0 0999 V2000
-4.2075 -0.9369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2075 -0.1095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4911 0.3040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4911 1.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7747 1.5480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0609 1.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2546 1.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9237 2.1198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1199 2.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3510 1.5502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0241 0.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7827 0.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2760 0.0612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0609 0.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7728 -0.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6270 0.2822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3314 0.6843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1693 1.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6270 -0.5451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3434 -0.9587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0600 -0.5452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7740 -0.9583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7740 -1.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0619 -2.1989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3434 -1.7896 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4938 -2.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2075 -1.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2075 -0.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4888 -0.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0894 -0.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
6 7 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
7 12 2 0
13 12 1 0
14 13 1 0
14 6 2 0
15 14 1 0
3 15 2 0
11 16 2 0
16 17 1 0
18 17 2 0
10 18 1 0
16 19 1 0
19 20 1 0
21 20 2 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 2 0
20 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
22 29 1 0
19 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.43Molecular Weight (Monoisotopic): 394.1430AlogP: 4.38#Rotatable Bonds: 3Polar Surface Area: 72.80Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.07CX LogP: 4.07CX LogD: 4.07Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.46Np Likeness Score: -0.31