ID: ALA5286864

Max Phase: Preclinical

Molecular Formula: C29H26N4O3

Molecular Weight: 478.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccccc1)Nc1ccc2n(c1=O)C[C@@H]1C[C@H]2CN(C(=O)c2ccc3ccccc3c2)C1

Standard InChI:  InChI=1S/C29H26N4O3/c34-27(22-11-10-20-6-4-5-7-21(20)15-22)32-16-19-14-23(18-32)26-13-12-25(28(35)33(26)17-19)31-29(36)30-24-8-2-1-3-9-24/h1-13,15,19,23H,14,16-18H2,(H2,30,31,36)/t19-,23+/m1/s1

Standard InChI Key:  ADABNAXLEVJLHU-XXBNENTESA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -1.7835    1.6628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0522    2.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    1.6023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3908    0.7781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1221    0.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8184    0.8386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2556    2.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3234    1.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3892    1.9837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5477    0.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444    0.9006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115    1.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4829    2.1069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5477   -0.3663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9586    0.4883    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9586   -0.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6729   -0.7487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444   -0.7487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444   -1.5735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5302   -1.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5310   -2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454   -3.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9569   -2.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9617   -1.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    2.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    3.2208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8177    1.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2438    1.9841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5321    2.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2438    1.1591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5339    0.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8177    1.1554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6711    1.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9563    2.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6729    1.1616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9614    0.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0173    2.8687    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1774   -0.0185    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  2  7  1  0
  4  8  1  0
  8  9  1  0
  7  9  1  0
  6 10  1  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
  1 13  2  0
 10 14  2  0
 11 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
  9 25  1  0
 25 26  2  0
 25 27  1  0
 28 29  1  0
 29 27  2  0
 30 28  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 33 34  2  0
 28 34  1  0
 35 33  1  0
 36 35  2  0
 30 36  1  0
  2 37  1  1
  4 38  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5286864

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.55Molecular Weight (Monoisotopic): 478.2005AlogP: 4.91#Rotatable Bonds: 3
Polar Surface Area: 83.44Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.09CX Basic pKa: CX LogP: 3.02CX LogD: 3.02
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.24

References

1. Allardyce D, Adu Mantey P, Szalecka M, Nkwo R, Loizidou EZ..  (2023)  Identification of a new class of proteasome inhibitors based on a naphthyl-azotricyclic-urea-phenyl scaffold.,  14  (3): [PMID:36970145] [10.1039/d2md00404f]

Source