(R)-tert-butyl 1-(5-((3-benzoyl-5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methyl)isoxazol-3-yl)-2-phenylethylcarbamate

ID: ALA5286865

Max Phase: Preclinical

Molecular Formula: C29H30N4O6

Molecular Weight: 530.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(Cc2cc([C@@H](Cc3ccccc3)NC(=O)OC(C)(C)C)no2)c(=O)n(C(=O)c2ccccc2)c1=O

Standard InChI:  InChI=1S/C29H30N4O6/c1-19-17-32(28(37)33(25(19)34)26(35)21-13-9-6-10-14-21)18-22-16-24(31-39-22)23(15-20-11-7-5-8-12-20)30-27(36)38-29(2,3)4/h5-14,16-17,23H,15,18H2,1-4H3,(H,30,36)/t23-/m1/s1

Standard InChI Key:  YFYSSQKUJYDXQQ-HSZRJFAPSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    0.3093   -0.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0238   -0.0753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7383   -0.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7383   -1.3129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0238   -1.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3093   -1.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4049   -1.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4526   -1.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0238   -2.5501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4526   -0.0754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0238    0.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3095    1.1618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4046    0.7494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0230    1.3205    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6926    2.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1311    1.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1049    2.7690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9298    2.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    2.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1669    2.0547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9298    1.3404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3421    0.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9298   -0.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1669    0.6261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7545   -0.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6926    3.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1321    3.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5447    4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3671    4.1967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7796    3.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3706    2.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5463    2.7659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1669   -1.3129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4526   -2.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1668   -2.9626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1661   -3.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4516   -4.1975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7400   -3.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7352   -2.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  2  0
  6  5  1  0
  6  7  1  0
  4  8  1  0
  5  9  2  0
  3 10  2  0
  2 11  1  0
 11 12  1  0
 13 12  1  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 12 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 17 26  1  6
 26 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
  8 33  2  0
  8 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286865

    ---

Associated Targets(non-human)

Coxsackievirus B3 (1096 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.58Molecular Weight (Monoisotopic): 530.2165AlogP: 3.85#Rotatable Bonds: 7
Polar Surface Area: 125.43Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.14CX Basic pKa: CX LogP: 4.54CX LogD: 4.54
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.38Np Likeness Score: -0.93

References

1. Sysak A, Obmińska-Mrukowicz B..  (2017)  Isoxazole ring as a useful scaffold in a search for new therapeutic agents.,  137  [PMID:28605676] [10.1016/j.ejmech.2017.06.002]

Source