The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
diethyl (3-(4-((1,3-dioxo-1H-benzo[de]isoquinolin-2(3H)-yl)methyl)-1H-1,2,3-triazol-1-yl)-2-hydroxypropyl)phosphonate ID: ALA5286871
Max Phase: Preclinical
Molecular Formula: C22H25N4O6P
Molecular Weight: 472.44
Associated Items:
Names and Identifiers Canonical SMILES: CCOP(=O)(CC(O)Cn1cc(CN2C(=O)c3cccc4cccc(c34)C2=O)nn1)OCC
Standard InChI: InChI=1S/C22H25N4O6P/c1-3-31-33(30,32-4-2)14-17(27)13-25-11-16(23-24-25)12-26-21(28)18-9-5-7-15-8-6-10-19(20(15)18)22(26)29/h5-11,17,27H,3-4,12-14H2,1-2H3
Standard InChI Key: LNPTVOXNPMSALZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.7089 -1.0476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9942 -1.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2816 -1.0470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2816 -0.2227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5678 0.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3895 0.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5662 1.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1540 1.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6702 1.7956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0824 2.5095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9067 2.5095 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-2.3188 3.2233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1432 3.2233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5553 3.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7029 2.2961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9163 1.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7125 1.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1201 1.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0824 1.0817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2358 0.3479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.8539 -0.2227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5667 -1.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8536 -1.0463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5667 -2.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2801 -2.6953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9942 -2.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -2.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -3.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9993 -3.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2801 -3.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5685 -3.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8507 -3.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8507 -2.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
11 15 1 0
15 16 1 0
16 17 1 0
11 18 2 0
9 19 1 0
20 7 1 0
21 20 2 0
21 5 1 0
3 22 1 0
22 23 2 0
24 22 1 0
25 24 1 0
25 26 1 0
26 2 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
30 25 2 0
31 30 1 0
32 31 2 0
33 32 1 0
24 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.44Molecular Weight (Monoisotopic): 472.1512AlogP: 2.85#Rotatable Bonds: 10Polar Surface Area: 123.85Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.15CX LogP: 1.21CX LogD: 1.21Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -0.90
References 1. Tomczyk MD, Walczak KZ.. (2018) l,8-Naphthalimide based DNA intercalators and anticancer agents. A systematic review from 2007 to 2017., 159 [PMID:30312931 ] [10.1016/j.ejmech.2018.09.055 ]