6-(((2,2-dimethylchroman-6-yl)oxy)methyl)-N2-(p-tolyl)-1,3,5-triazine-2,4-diamine

ID: ALA5286873

Max Phase: Preclinical

Molecular Formula: C22H25N5O2

Molecular Weight: 391.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(Nc2nc(N)nc(COc3ccc4c(c3)CCC(C)(C)O4)n2)cc1

Standard InChI:  InChI=1S/C22H25N5O2/c1-14-4-6-16(7-5-14)24-21-26-19(25-20(23)27-21)13-28-17-8-9-18-15(12-17)10-11-22(2,3)29-18/h4-9,12H,10-11,13H2,1-3H3,(H3,23,24,25,26,27)

Standard InChI Key:  QYEWHIXPEWHDHQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.8149   -0.8227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0997   -0.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0997    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3798    0.8281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6633    0.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6633   -0.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3844   -0.8300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0547   -0.8282    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7728   -0.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4908   -0.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2061   -0.4144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9241   -0.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6421   -0.4141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6421    0.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9210    0.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9210    1.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6411    2.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3594    1.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3594    0.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9241   -1.6611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2043   -2.0712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4908   -1.6574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2043   -2.9003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8118    0.8273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5287    0.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5287   -0.4088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6411    2.9003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3594    0.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9448    1.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  2  2  0
  8  6  1  0
  9  8  1  0
 10  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 14  2  0
 12 20  1  0
 20 21  2  0
 21 22  1  0
 22 10  2  0
 21 23  1  0
  3 24  1  0
 25 24  1  0
 26 25  1  0
  1 26  1  0
 17 27  1  0
 25 28  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286873

    ---

Associated Targets(Human)

FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 391.48Molecular Weight (Monoisotopic): 391.2008AlogP: 4.19#Rotatable Bonds: 5
Polar Surface Area: 95.18Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.05CX Basic pKa: 4.11CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -0.82

References

1. Lückmann M, Shenol A, Nissen TAD, Petersen JE, Kouvchinov D, Schwartz TW, Frimurer TM..  (2022)  Optimization of First-in-Class Dual-Acting FFAR1/FFAR4 Allosteric Modulators with Novel Mode of Action.,  13  (12.0): [PMID:36518697] [10.1021/acsmedchemlett.2c00160]

Source