(3-hydroxyquinoxalin-2-yl)(2-(piperidin-1-ylmethyl)pyrrolidin-1-yl)methanone

ID: ALA5286983

Max Phase: Preclinical

Molecular Formula: C19H24N4O2

Molecular Weight: 340.43

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1nc2ccccc2nc1O)N1CCCC1CN1CCCCC1

Standard InChI:  InChI=1S/C19H24N4O2/c24-18-17(20-15-8-2-3-9-16(15)21-18)19(25)23-12-6-7-14(23)13-22-10-4-1-5-11-22/h2-3,8-9,14H,1,4-7,10-13H2,(H,21,24)

Standard InChI Key:  ZKSPPMSFNLEJTM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -2.7839   -2.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5007   -1.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5007   -1.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7857   -0.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0733   -1.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0733   -1.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3550   -2.3559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6429   -1.9389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6447   -1.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3601   -0.7045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0703   -0.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0703    0.1212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5973    0.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3423    1.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4830    1.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7381    0.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5356    0.3926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1196    0.9765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9060    1.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4888    2.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2866    2.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5007    1.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9205    0.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7854   -1.1173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0720   -2.3518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5 10  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 16 17  1  0
 17 18  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
 18 23  1  0
 11 24  2  0
  8 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286983

    ---

Associated Targets(Human)

FABP4 Tchem Fatty acid binding protein adipocyte (764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 340.43Molecular Weight (Monoisotopic): 340.1899AlogP: 2.43#Rotatable Bonds: 3
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.21CX Basic pKa: 8.46CX LogP: 3.09CX LogD: 2.13
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.93Np Likeness Score: -1.18

References

1. Floresta G, Pistarà V, Amata E, Dichiara M, Marrazzo A, Prezzavento O, Rescifina A..  (2017)  Adipocyte fatty acid binding protein 4 (FABP4) inhibitors. A comprehensive systematic review.,  138  [PMID:28738306] [10.1016/j.ejmech.2017.07.022]

Source