The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((5-(7-bromo-3-methyl-1-oxo-1,2-dihydronaphthalen-2-yl)-4H-1,2,4-triazol-3-yl)thio)-N-(3-chloro-2-(o-tolyl)cyclobutyl)acetamide ID: ALA5286984
Max Phase: Preclinical
Molecular Formula: C26H24BrClN4O2S
Molecular Weight: 571.93
Associated Items:
Names and Identifiers Canonical SMILES: CC1=Cc2ccc(Br)cc2C(=O)C1c1nnc(SCC(=O)NC2CC(Cl)C2c2ccccc2C)[nH]1
Standard InChI: InChI=1S/C26H24BrClN4O2S/c1-13-5-3-4-6-17(13)23-19(28)11-20(23)29-21(33)12-35-26-30-25(31-32-26)22-14(2)9-15-7-8-16(27)10-18(15)24(22)34/h3-10,19-20,22-23H,11-12H2,1-2H3,(H,29,33)(H,30,31,32)
Standard InChI Key: SWMQBXVGFCWDHY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-4.7438 -1.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0292 -1.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3173 -1.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3173 -2.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0274 -3.2111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7438 -2.8030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6027 -3.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8880 -2.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8880 -1.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6027 -1.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6027 -0.7364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1734 -1.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0872 -0.7413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2804 -0.5699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1319 -1.2841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4200 -1.8971 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9571 -1.2841 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3697 -0.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1949 -0.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6075 0.1451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4327 0.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0260 0.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6097 0.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0162 -0.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4349 0.1549 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0260 1.5637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3116 1.9765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3123 2.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0271 3.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7391 2.8027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7438 1.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6075 -1.2841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1734 -3.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4585 -1.5619 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.4585 1.5654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
3 10 1 0
10 11 2 0
12 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
22 21 1 0
23 22 1 0
23 24 1 0
24 21 1 0
23 25 1 0
26 22 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
19 32 2 0
8 33 1 0
1 34 1 0
31 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.93Molecular Weight (Monoisotopic): 570.0492AlogP: 5.63#Rotatable Bonds: 6Polar Surface Area: 87.74Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.04CX Basic pKa: 1.42CX LogP: 4.74CX LogD: 4.34Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.67
References 1. Plescia F, Maggio B, Daidone G, Raffa D.. (2021) 4-(3H)-quinazolinones N-3 substituted with a five membered heterocycle: A promising scaffold towards bioactive molecules., 213 [PMID:33309162 ] [10.1016/j.ejmech.2020.113070 ]