2-((5-(7-bromo-3-methyl-1-oxo-1,2-dihydronaphthalen-2-yl)-4H-1,2,4-triazol-3-yl)thio)-N-(3-chloro-2-(o-tolyl)cyclobutyl)acetamide

ID: ALA5286984

Max Phase: Preclinical

Molecular Formula: C26H24BrClN4O2S

Molecular Weight: 571.93

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=Cc2ccc(Br)cc2C(=O)C1c1nnc(SCC(=O)NC2CC(Cl)C2c2ccccc2C)[nH]1

Standard InChI:  InChI=1S/C26H24BrClN4O2S/c1-13-5-3-4-6-17(13)23-19(28)11-20(23)29-21(33)12-35-26-30-25(31-32-26)22-14(2)9-15-7-8-16(27)10-18(15)24(22)34/h3-10,19-20,22-23H,11-12H2,1-2H3,(H,29,33)(H,30,31,32)

Standard InChI Key:  SWMQBXVGFCWDHY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -4.7438   -1.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0292   -1.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3173   -1.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3173   -2.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0274   -3.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7438   -2.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6027   -3.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8880   -2.7994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8880   -1.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6027   -1.5616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6027   -0.7364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1734   -1.5616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0872   -0.7413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2804   -0.5699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1319   -1.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4200   -1.8971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9571   -1.2841    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.3697   -0.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1949   -0.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6075    0.1451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4327    0.1451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0260    0.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6097    0.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0162   -0.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4349    0.1549    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.0260    1.5637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3116    1.9765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3123    2.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0271    3.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7391    2.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7438    1.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6075   -1.2841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1734   -3.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4585   -1.5619    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    5.4585    1.5654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  3 10  1  0
 10 11  2  0
 12  9  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 23 22  1  0
 23 24  1  0
 24 21  1  0
 23 25  1  0
 26 22  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 19 32  2  0
  8 33  1  0
  1 34  1  0
 31 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286984

    ---

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 571.93Molecular Weight (Monoisotopic): 570.0492AlogP: 5.63#Rotatable Bonds: 6
Polar Surface Area: 87.74Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.04CX Basic pKa: 1.42CX LogP: 4.74CX LogD: 4.34
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.67

References

1. Plescia F, Maggio B, Daidone G, Raffa D..  (2021)  4-(3H)-quinazolinones N-3 substituted with a five membered heterocycle: A promising scaffold towards bioactive molecules.,  213  [PMID:33309162] [10.1016/j.ejmech.2020.113070]

Source