The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R,3R,4S,5R,6R)-2-(2-(3-benzyl-2,3-dihydro-1H-benzo[d]imidazol-1-yl)ethoxy)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol ID: ALA5287005
Max Phase: Preclinical
Molecular Formula: C22H28N2O6
Molecular Weight: 416.47
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@H]1O[C@@H](OCCN2CN(Cc3ccccc3)c3ccccc32)[C@H](O)[C@@H](O)[C@H]1O
Standard InChI: InChI=1S/C22H28N2O6/c25-13-18-19(26)20(27)21(28)22(30-18)29-11-10-23-14-24(12-15-6-2-1-3-7-15)17-9-5-4-8-16(17)23/h1-9,18-22,25-28H,10-14H2/t18-,19+,20+,21-,22-/m1/s1
Standard InChI Key: YRAXQDBZLUSJNH-CDJZJNNCSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
2.9802 0.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1925 0.2566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8699 -0.4598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0660 -0.3698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8919 0.4114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5890 0.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7698 1.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5543 1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1561 1.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1948 0.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5022 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1993 0.8139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8964 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8964 -0.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1993 -0.7961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5937 -0.7963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5937 -1.6012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2909 -0.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9881 -0.7961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2909 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9881 0.8139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6851 0.4114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5937 0.8140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2724 -1.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0773 -1.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4800 -0.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2825 -0.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6851 -1.1579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2860 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4815 -1.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 2 2 0
6 7 1 0
8 7 2 0
9 8 1 0
1 9 2 0
10 5 1 0
11 10 1 0
12 11 1 0
13 12 1 1
14 13 1 0
14 15 1 6
16 14 1 0
16 17 1 1
18 16 1 0
18 19 1 1
20 18 1 0
20 21 1 1
21 22 1 0
20 23 1 0
13 23 1 0
3 24 1 0
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.47Molecular Weight (Monoisotopic): 416.1947AlogP: 0.29#Rotatable Bonds: 7Polar Surface Area: 105.86Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 1.39CX LogD: 1.39Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.51Np Likeness Score: 0.65
References 1. Lopes JPB, Silva L, Lüdtke DS.. (2021) An overview on the synthesis of carbohydrate-based molecules with biological activity related to neurodegenerative diseases., 12 (12.0): [PMID:35028560 ] [10.1039/D1MD00217A ]