The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5287112
Max Phase: Preclinical
Molecular Formula: C29H25ClN4O3
Molecular Weight: 513.00
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Cl)cc1)Nc1ccc2n(c1=O)C[C@@H]1C[C@H]2CN(C(=O)c2ccc3ccccc3c2)C1
Standard InChI: InChI=1S/C29H25ClN4O3/c30-23-7-9-24(10-8-23)31-29(37)32-25-11-12-26-22-13-18(16-34(26)28(25)36)15-33(17-22)27(35)21-6-5-19-3-1-2-4-20(19)14-21/h1-12,14,18,22H,13,15-17H2,(H2,31,32,37)/t18-,22+/m1/s1
Standard InChI Key: QPYKOKWFFLREBN-GCJKJVERSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
-1.7835 2.0752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0522 2.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3558 2.0147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3908 1.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1221 0.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8184 1.2510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2556 2.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3234 1.6646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3892 2.3961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5477 0.8707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2444 1.3130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2115 2.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4829 2.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5477 0.0460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9586 0.9007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9586 0.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6729 -0.3363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2444 -0.3363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2444 -1.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5302 -1.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5310 -2.3960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2454 -2.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9569 -2.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9617 -1.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1034 2.8085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1034 3.6332 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8177 2.3961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2438 2.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5321 2.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2438 1.5715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5339 1.1598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8177 1.5678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6711 2.3949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9563 2.8072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6729 1.5740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9614 1.1575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0173 3.2811 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.1774 0.3938 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2454 -3.6332 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
2 7 1 0
4 8 1 0
8 9 1 0
7 9 1 0
6 10 1 0
11 10 1 0
12 11 2 0
13 12 1 0
1 13 2 0
10 14 2 0
11 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
9 25 1 0
25 26 2 0
25 27 1 0
28 29 1 0
29 27 2 0
30 28 2 0
31 30 1 0
32 31 2 0
27 32 1 0
33 34 2 0
28 34 1 0
35 33 1 0
36 35 2 0
30 36 1 0
2 37 1 1
4 38 1 1
22 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.00Molecular Weight (Monoisotopic): 512.1615AlogP: 5.56#Rotatable Bonds: 3Polar Surface Area: 83.44Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.08CX Basic pKa: ┄CX LogP: 3.62CX LogD: 3.62Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.39
References 1. Allardyce D, Adu Mantey P, Szalecka M, Nkwo R, Loizidou EZ.. (2023) Identification of a new class of proteasome inhibitors based on a naphthyl-azotricyclic-urea-phenyl scaffold., 14 (3): [PMID:36970145 ] [10.1039/d2md00404f ]