ID: ALA5287112

Max Phase: Preclinical

Molecular Formula: C29H25ClN4O3

Molecular Weight: 513.00

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(Cl)cc1)Nc1ccc2n(c1=O)C[C@@H]1C[C@H]2CN(C(=O)c2ccc3ccccc3c2)C1

Standard InChI:  InChI=1S/C29H25ClN4O3/c30-23-7-9-24(10-8-23)31-29(37)32-25-11-12-26-22-13-18(16-34(26)28(25)36)15-33(17-22)27(35)21-6-5-19-3-1-2-4-20(19)14-21/h1-12,14,18,22H,13,15-17H2,(H2,31,32,37)/t18-,22+/m1/s1

Standard InChI Key:  QPYKOKWFFLREBN-GCJKJVERSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   -1.7835    2.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0522    2.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    2.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3908    1.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1221    0.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8184    1.2510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2556    2.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3234    1.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3892    2.3961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5477    0.8707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444    1.3130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2115    2.1332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4829    2.5193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5477    0.0460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9586    0.9007    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9586    0.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6729   -0.3363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444   -0.3363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2444   -1.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5302   -1.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5310   -2.3960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454   -2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9569   -2.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9617   -1.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    2.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1034    3.6332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8177    2.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2438    2.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5321    2.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2438    1.5715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5339    1.1598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8177    1.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6711    2.3949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9563    2.8072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6729    1.5740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9614    1.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0173    3.2811    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1774    0.3938    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2454   -3.6332    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  2  7  1  0
  4  8  1  0
  8  9  1  0
  7  9  1  0
  6 10  1  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
  1 13  2  0
 10 14  2  0
 11 15  1  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
  9 25  1  0
 25 26  2  0
 25 27  1  0
 28 29  1  0
 29 27  2  0
 30 28  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
 33 34  2  0
 28 34  1  0
 35 33  1  0
 36 35  2  0
 30 36  1  0
  2 37  1  1
  4 38  1  1
 22 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287112

    ---

Associated Targets(Human)

PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.00Molecular Weight (Monoisotopic): 512.1615AlogP: 5.56#Rotatable Bonds: 3
Polar Surface Area: 83.44Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.08CX Basic pKa: CX LogP: 3.62CX LogD: 3.62
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.38Np Likeness Score: -1.39

References

1. Allardyce D, Adu Mantey P, Szalecka M, Nkwo R, Loizidou EZ..  (2023)  Identification of a new class of proteasome inhibitors based on a naphthyl-azotricyclic-urea-phenyl scaffold.,  14  (3): [PMID:36970145] [10.1039/d2md00404f]

Source