2,2-dimethyl-N-[(3S)-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-N'-propylbutanediamide

ID: ALA5287140

Max Phase: Preclinical

Molecular Formula: C25H30N4O3

Molecular Weight: 434.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCNC(=O)CC(C)(C)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O

Standard InChI:  InChI=1S/C25H30N4O3/c1-5-15-26-20(30)16-25(2,3)24(32)28-22-23(31)29(4)19-14-10-9-13-18(19)21(27-22)17-11-7-6-8-12-17/h6-14,22H,5,15-16H2,1-4H3,(H,26,30)(H,28,32)/t22-/m1/s1

Standard InChI Key:  PACYYBQOQIZQEP-JOCHJYFZSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -4.5089    0.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7943    1.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0821    0.6374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0821   -0.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7923   -0.5992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5089   -0.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4279   -0.7030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6216   -0.5127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2681    0.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6355    0.9791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4397    1.1556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6531    1.9528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0518    1.5628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4428    0.2337    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0302    0.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7950    0.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2078    1.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0331    1.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4458    2.3777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2711    2.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6836    3.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5089    3.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4458    0.9483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4428    1.6629    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6413   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0580   -2.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2716   -2.8787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0691   -3.0923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6509   -2.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4420   -1.7149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7950    0.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5097    0.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  7  8  2  0
  9  8  1  0
 10  9  1  0
  3 11  1  0
 11 10  1  0
 11 12  1  0
 10 13  2  0
  9 14  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 18 23  2  0
 15 24  2  0
  7 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 16 31  1  0
 16 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287140

    ---

Associated Targets(non-human)

Cryptosporidium parvum (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.54Molecular Weight (Monoisotopic): 434.2318AlogP: 2.89#Rotatable Bonds: 7
Polar Surface Area: 90.87Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.60CX Basic pKa: 0.93CX LogP: 3.12CX LogD: 3.12
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.70Np Likeness Score: -0.34

References

1. Lee S, Love MS, Modukuri R, Chatterjee AK, Huerta L, Lawson AP, McNamara CW, Mead JR, Hedstrom L, Cuny GD..  (2023)  Structure-activity relationship of BMS906024 derivatives for Cryptosporidium parvum growth inhibition.,  90  [PMID:37196868] [10.1016/j.bmcl.2023.129328]

Source