The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4S)-3-((N-benzyl-2-(2,6-dimethylphenoxy)acetamido)methyl)-4-((N-isobutylphenylsulfonamido)methyl)pyrrolidinium ID: ALA5287187
Max Phase: Preclinical
Molecular Formula: C33H43N3O4S
Molecular Weight: 577.79
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(C)c1OCC(=O)N(Cc1ccccc1)C[C@@H]1CNC[C@H]1CN(CC(C)C)S(=O)(=O)c1ccccc1
Standard InChI: InChI=1S/C33H43N3O4S/c1-25(2)20-36(41(38,39)31-16-9-6-10-17-31)23-30-19-34-18-29(30)22-35(21-28-14-7-5-8-15-28)32(37)24-40-33-26(3)12-11-13-27(33)4/h5-17,25,29-30,34H,18-24H2,1-4H3/t29-,30-/m0/s1
Standard InChI Key: MQRMHPRUUKDEKO-KYJUHHDHSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
14.4627 -19.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1177 -19.8207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7984 -19.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5630 -18.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7390 -18.5430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0048 -17.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8291 -17.8981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2708 -17.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2118 -18.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0951 -17.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8880 -16.4704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5367 -16.5384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3610 -16.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7387 -17.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5622 -17.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0047 -16.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6177 -15.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7954 -15.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4091 -15.1487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2947 -18.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0199 -18.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2990 -19.5432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1063 -19.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6339 -19.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3486 -18.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5420 -18.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2708 -17.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4484 -17.9295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9802 -17.2504 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0942 -18.6748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2718 -18.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9177 -19.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8036 -18.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3343 -16.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3920 -16.6588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2628 -17.6545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1574 -16.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5116 -15.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0431 -15.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2167 -15.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8664 -15.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 1 6
6 7 1 0
7 8 1 0
7 9 1 0
8 10 1 0
8 11 2 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
18 19 1 0
14 20 1 0
9 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
5 27 1 1
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
29 34 1 0
29 35 2 0
29 36 2 0
34 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.79Molecular Weight (Monoisotopic): 577.2974AlogP: 4.89#Rotatable Bonds: 13Polar Surface Area: 78.95Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 11.01CX LogP: 5.15CX LogD: 2.06Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -1.15
References 1. Ghosh AK, Osswald HL, Prato G.. (2016) Recent Progress in the Development of HIV-1 Protease Inhibitors for the Treatment of HIV/AIDS., 59 (11): [PMID:26799988 ] [10.1021/acs.jmedchem.5b01697 ]