The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5287265
Max Phase: Preclinical
Molecular Formula: C24H23N5O3
Molecular Weight: 429.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccccc1)Nc1ccc2n(c1=O)C[C@@H]1C[C@H]2CN(C(=O)c2ccccn2)C1
Standard InChI: InChI=1S/C24H23N5O3/c30-22(19-8-4-5-11-25-19)28-13-16-12-17(15-28)21-10-9-20(23(31)29(21)14-16)27-24(32)26-18-6-2-1-3-7-18/h1-11,16-17H,12-15H2,(H2,26,27,32)/t16-,17+/m1/s1
Standard InChI Key: YMADCEPSWWDWLO-SJORKVTESA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.0690 1.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3377 2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3585 1.6024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3236 0.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4076 0.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1039 0.8386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4588 2.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0379 1.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1038 1.9838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8333 0.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5300 0.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4970 1.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7685 2.1070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8333 -0.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2442 0.4883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2442 -0.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9585 -0.7487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5300 -0.7487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5300 -1.5736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8157 -1.9862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8165 -2.8084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5310 -3.2210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2425 -2.8120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2473 -1.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8181 2.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8181 3.2210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5323 1.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3028 2.8689 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.5371 -0.0184 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.2468 2.3960 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9585 1.9842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9585 1.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2486 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5323 1.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
2 7 1 0
4 8 1 0
8 9 1 0
7 9 1 0
6 10 1 0
11 10 1 0
12 11 2 0
13 12 1 0
1 13 2 0
10 14 2 0
11 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
9 25 1 0
25 26 2 0
25 27 1 0
2 28 1 1
4 29 1 1
30 27 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
27 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 429.48Molecular Weight (Monoisotopic): 429.1801AlogP: 3.15#Rotatable Bonds: 3Polar Surface Area: 96.33Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.09CX Basic pKa: 2.07CX LogP: 1.19CX LogD: 1.19Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.67Np Likeness Score: -1.59
References 1. Allardyce D, Adu Mantey P, Szalecka M, Nkwo R, Loizidou EZ.. (2023) Identification of a new class of proteasome inhibitors based on a naphthyl-azotricyclic-urea-phenyl scaffold., 14 (3): [PMID:36970145 ] [10.1039/d2md00404f ]