The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-2-(2-oxo-2-(3-(pyridin-3-yl)phenyl)ethyl)benzoic acid ID: ALA5287267
Max Phase: Preclinical
Molecular Formula: C26H25NO5
Molecular Weight: 431.49
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c(C(=O)O)c(CC(=O)c2cccc(-c3cccnc3)c2)c1CC=C(C)C
Standard InChI: InChI=1S/C26H25NO5/c1-16(2)9-10-20-21(25(26(30)31)23(29)14-24(20)32-3)13-22(28)18-7-4-6-17(12-18)19-8-5-11-27-15-19/h4-9,11-12,14-15,29H,10,13H2,1-3H3,(H,30,31)
Standard InChI Key: DTWKYEPZXFGVCF-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-2.8560 1.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1414 1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4296 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4296 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1396 0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8560 0.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5707 -0.0041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5707 -0.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1396 -0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8543 -1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8543 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5689 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1396 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 -0.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0003 -1.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 -1.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4265 -2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7162 -2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0003 -2.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1412 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4296 -1.2382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7149 2.4751 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0003 1.2373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1414 2.4744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1414 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8542 0.4107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5691 -0.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5707 -0.8230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -1.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
5 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
11 13 1 0
4 14 1 0
14 15 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
18 22 1 0
15 23 2 0
3 24 1 0
24 25 2 0
24 26 1 0
2 27 1 0
28 22 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
22 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1733AlogP: 5.10#Rotatable Bonds: 8Polar Surface Area: 96.72Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.83CX Basic pKa: 4.72CX LogP: 4.17CX LogD: 2.02Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: 0.48
References 1. Xu XT, Shi LY, Ban YJ, Luo BL, Zhu GF, Guo B, Tang L, Sang ZP, Wang JT.. (2023) Design, synthesis and biological evaluation of cajanonic acid A analogues as potent PPAR γ antagonists., 80 [PMID:36414176 ] [10.1016/j.bmcl.2022.129081 ]