6-hydroxy-4-methoxy-3-(3-methylbut-2-en-1-yl)-2-(2-oxo-2-(3-(pyridin-3-yl)phenyl)ethyl)benzoic acid

ID: ALA5287267

Max Phase: Preclinical

Molecular Formula: C26H25NO5

Molecular Weight: 431.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c(C(=O)O)c(CC(=O)c2cccc(-c3cccnc3)c2)c1CC=C(C)C

Standard InChI:  InChI=1S/C26H25NO5/c1-16(2)9-10-20-21(25(26(30)31)23(29)14-24(20)32-3)13-22(28)18-7-4-6-17(12-18)19-8-5-11-27-15-19/h4-9,11-12,14-15,29H,10,13H2,1-3H3,(H,30,31)

Standard InChI Key:  DTWKYEPZXFGVCF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -2.8560    1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1414    1.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4296    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4296    0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1396    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8560    0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5707   -0.0041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5707   -0.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1396   -0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8543   -1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8543   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5689   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1396   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003   -1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7144   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4265   -1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4265   -2.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7162   -2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003   -2.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1412   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4296   -1.2382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7149    2.4751    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003    1.2373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1414    2.4744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1414    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8542    0.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5691   -0.0019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5707   -0.8230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8588   -1.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  5  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
 18 22  1  0
 15 23  2  0
  3 24  1  0
 24 25  2  0
 24 26  1  0
  2 27  1  0
 28 22  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 22 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287267

    ---

Associated Targets(Human)

PPARG Tclin Peroxisome proliferator-activated receptor gamma (15191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.49Molecular Weight (Monoisotopic): 431.1733AlogP: 5.10#Rotatable Bonds: 8
Polar Surface Area: 96.72Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.83CX Basic pKa: 4.72CX LogP: 4.17CX LogD: 2.02
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.38Np Likeness Score: 0.48

References

1. Xu XT, Shi LY, Ban YJ, Luo BL, Zhu GF, Guo B, Tang L, Sang ZP, Wang JT..  (2023)  Design, synthesis and biological evaluation of cajanonic acid A analogues as potent PPAR γ antagonists.,  80  [PMID:36414176] [10.1016/j.bmcl.2022.129081]

Source