(S,E)-2-{4-[2-Hydroxy-3-(1-benzylpiperidin-4-yl)-amino]propoxyphenyl}-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one

ID: ALA5287268

Max Phase: Preclinical

Molecular Formula: C31H36N2O6

Molecular Weight: 532.64

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)O[C@H](c1ccc(OCC(O)CNC3CCN(Cc4ccccc4)CC3)cc1)CC2=O

Standard InChI:  InChI=1S/C31H36N2O6/c1-37-26-15-27(35)31-28(36)17-29(39-30(31)16-26)22-7-9-25(10-8-22)38-20-24(34)18-32-23-11-13-33(14-12-23)19-21-5-3-2-4-6-21/h2-10,15-16,23-24,29,32,34-35H,11-14,17-20H2,1H3/t24?,29-/m0/s1

Standard InChI Key:  OERWPBXFLGDFDU-PEFOLFAWSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -3.5691   -2.2676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5691   -1.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8576   -1.0261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8594   -0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5742    0.2070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2867   -0.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2867   -1.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9965   -1.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9965   -2.2652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7127   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7127   -0.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4272    0.2083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1416   -0.2040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9983    0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450    0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4275   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7158    0.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7174    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4320    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1447    1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0030    1.4426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7114    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    1.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1403    1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    2.2676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1403    0.2051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8547   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5691    0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2835   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2835   -1.0322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5691   -1.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8547   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9980   -1.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7125   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7127   -0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4254    0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1400   -0.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1416   -1.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4299   -1.4464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  0
  7  6  2  0
  7  2  1  0
  8  7  1  0
  8  9  1  0
 10  8  2  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 14 11  2  0
  6 14  1  0
  4 15  1  6
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 24 26  1  0
 26 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 27 32  1  0
 30 33  1  0
 33 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287268

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.64Molecular Weight (Monoisotopic): 532.2573AlogP: 4.10#Rotatable Bonds: 10
Polar Surface Area: 100.49Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.65CX Basic pKa: 9.67CX LogP: 2.92CX LogD: 1.75
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.36Np Likeness Score: 0.13

References

1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU..  (2020)  Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer.,  28  (23.0): [PMID:33038666] [10.1016/j.bmc.2020.115798]

Source