methyl (4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)benzoyl)-L-phenylalaninate

ID: ALA5287291

Max Phase: Preclinical

Molecular Formula: C26H24N4O4S

Molecular Weight: 488.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(Sc2c(C)ccc3nc(N)[nH]c(=O)c23)cc1

Standard InChI:  InChI=1S/C26H24N4O4S/c1-15-8-13-19-21(24(32)30-26(27)29-19)22(15)35-18-11-9-17(10-12-18)23(31)28-20(25(33)34-2)14-16-6-4-3-5-7-16/h3-13,20H,14H2,1-2H3,(H,28,31)(H3,27,29,30,32)/t20-/m0/s1

Standard InChI Key:  YIZPCOSGVJNHMW-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    0.7183   -1.8658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7183   -1.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0038   -0.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7063   -1.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4228   -0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4228    0.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1373    0.6090    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1373    1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8535    1.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8535    2.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5741    3.0861    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2885    2.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2885    1.8437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5690    1.4296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5690    0.6046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0029    3.0804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1391    3.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274    2.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4274    1.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128    1.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7081    0.6088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0038    0.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4327   -0.6283    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1473   -1.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8618   -0.6283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5762   -1.0408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2909   -0.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0029   -1.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0029   -1.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2927   -2.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5762   -1.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1473   -1.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8748   -2.2859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4239   -2.2612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4239   -3.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
  9 14  1  0
 14 15  2  0
 12 16  1  0
 17 10  2  0
 18 17  1  0
 19 18  2  0
  8 19  1  0
 19 20  1  0
 21  6  2  0
 22 21  1  0
  3 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 24 32  1  1
 32 33  2  0
 32 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287291

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.57Molecular Weight (Monoisotopic): 488.1518AlogP: 3.48#Rotatable Bonds: 7
Polar Surface Area: 127.17Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.23CX Basic pKa: 3.40CX LogP: 4.12CX LogD: 4.12
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.60

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source