The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-ethylphenyl)-2-(6-(2-(5-phenyl-4H-1,2,4-triazol-3-ylthio)acetamido)benzo[d]thiazol-2-ylthio)acetamide ID: ALA5287311
Max Phase: Preclinical
Molecular Formula: C27H24N6O2S3
Molecular Weight: 560.73
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(NC(=O)CSc2nc3ccc(NC(=O)CSc4nnc(-c5ccccc5)[nH]4)cc3s2)cc1
Standard InChI: InChI=1S/C27H24N6O2S3/c1-2-17-8-10-19(11-9-17)28-24(35)16-37-27-30-21-13-12-20(14-22(21)38-27)29-23(34)15-36-26-31-25(32-33-26)18-6-4-3-5-7-18/h3-14H,2,15-16H2,1H3,(H,28,35)(H,29,34)(H,31,32,33)
Standard InChI Key: GODKGWMISMMYGY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-5.7867 3.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7867 2.6109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0733 2.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3662 2.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3662 3.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0751 3.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6547 2.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5688 1.3869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7654 1.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3548 1.9274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9044 2.5378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3548 0.5050 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.5336 0.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1230 -0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3019 -0.2061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1087 -0.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9299 -0.9173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3386 -1.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9279 -2.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1107 -2.3382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3036 -1.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4775 -2.9487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2278 -2.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1420 -1.7977 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9390 -3.0253 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6501 -2.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3613 -3.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0725 -2.6146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0725 -1.7935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3622 -1.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3622 -0.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0735 -0.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7867 -0.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7867 -1.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0735 0.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3624 1.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3613 -3.8464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5336 -0.9173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
7 4 1 0
8 7 1 0
9 8 1 0
10 9 2 0
11 10 1 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
19 22 1 0
23 22 2 0
24 23 1 0
18 24 1 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
32 35 1 0
35 36 1 0
27 37 2 0
14 38 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 560.73Molecular Weight (Monoisotopic): 560.1123AlogP: 6.11#Rotatable Bonds: 10Polar Surface Area: 112.66Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.31CX Basic pKa: 1.78CX LogP: 5.84CX LogD: 5.80Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -2.02