N-(4-ethylphenyl)-2-(6-(2-(5-phenyl-4H-1,2,4-triazol-3-ylthio)acetamido)benzo[d]thiazol-2-ylthio)acetamide

ID: ALA5287311

Max Phase: Preclinical

Molecular Formula: C27H24N6O2S3

Molecular Weight: 560.73

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1ccc(NC(=O)CSc2nc3ccc(NC(=O)CSc4nnc(-c5ccccc5)[nH]4)cc3s2)cc1

Standard InChI:  InChI=1S/C27H24N6O2S3/c1-2-17-8-10-19(11-9-17)28-24(35)16-37-27-30-21-13-12-20(14-22(21)38-27)29-23(34)15-36-26-31-25(32-33-26)18-6-4-3-5-7-18/h3-14H,2,15-16H2,1H3,(H,28,35)(H,29,34)(H,31,32,33)

Standard InChI Key:  GODKGWMISMMYGY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -5.7867    3.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7867    2.6109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0733    2.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3662    2.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3662    3.4362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0751    3.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6547    2.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5688    1.3869    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7654    1.2161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3548    1.9274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9044    2.5378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3548    0.5050    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5336    0.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1230   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3019   -0.2061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1087   -0.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9299   -0.9173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3386   -1.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9279   -2.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1107   -2.3382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3036   -1.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4775   -2.9487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2278   -2.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1420   -1.7977    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.9390   -3.0253    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6501   -2.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3613   -3.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0725   -2.6146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0725   -1.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3622   -1.3826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3622   -0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0735   -0.1532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7867   -0.5604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7867   -1.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0735    0.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3624    1.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3613   -3.8464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5336   -0.9173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  7  4  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
 19 22  1  0
 23 22  2  0
 24 23  1  0
 18 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 32 35  1  0
 35 36  1  0
 27 37  2  0
 14 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5287311

    ---

Associated Targets(non-human)

Genome polyprotein (620 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.73Molecular Weight (Monoisotopic): 560.1123AlogP: 6.11#Rotatable Bonds: 10
Polar Surface Area: 112.66Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.31CX Basic pKa: 1.78CX LogP: 5.84CX LogD: 5.80
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -2.02

References

1. Voss S, Nitsche C..  (2021)  Targeting the protease of West Nile virus.,  12  (8.0): [PMID:34458734] [10.1039/D1MD00080B]

Source