The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Mycotrienol I ID: ALA5287341
Max Phase: Preclinical
Molecular Formula: C26H33NO6
Molecular Weight: 455.55
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1/C=C/C=C/C=C/C[C@H](O)[C@H](C)[C@@H](O)/C(C)=C\CCC2=CC(=O)C=C(NC(=O)C1)C2=O
Standard InChI: InChI=1S/C26H33NO6/c1-17-10-9-11-19-14-20(28)15-22(26(19)32)27-24(30)16-21(33-3)12-7-5-4-6-8-13-23(29)18(2)25(17)31/h4-8,10,12,14-15,18,21,23,25,29,31H,9,11,13,16H2,1-3H3,(H,27,30)/b5-4+,8-6+,12-7+,17-10-/t18-,21-,23-,25-/m0/s1
Standard InChI Key: KDVQXJCAPWJRKD-OVININAMSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
0.0027 1.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7171 1.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7191 0.0011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0027 0.4092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7119 -0.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1439 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5732 0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5732 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8586 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1439 -2.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -2.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7147 -2.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 -2.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8586 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8586 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1439 0.0002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5733 -2.4752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2878 -2.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1439 -0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2878 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2878 0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7171 2.4752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5732 -2.4752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7191 -0.8240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 2 0
6 5 1 0
6 7 1 0
7 8 1 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 1 0
13 12 1 0
14 13 1 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 1 0
23 22 1 0
4 24 1 0
24 23 1 0
23 25 2 0
21 26 1 1
26 27 1 0
12 28 1 1
11 29 1 1
10 30 1 0
2 31 2 0
13 32 1 6
5 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.55Molecular Weight (Monoisotopic): 455.2308AlogP: 2.63#Rotatable Bonds: 1Polar Surface Area: 112.93Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.75CX Basic pKa: ┄CX LogP: 2.25CX LogD: 2.25Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: 1.93
References 1. Yang X, Wu W, Li H, Zhang M, Chu Z, Wang X, Sun P.. (2022) Natural occurrence, bioactivity, and biosynthesis of triene-ansamycins., 244 [PMID:36240545 ] [10.1016/j.ejmech.2022.114815 ]