4-(2-amino-4-ethyl-5-(3-(morpholinomethyl)phenyl)pyridin-3-yl)phenol

ID: ALA5287355

Max Phase: Preclinical

Molecular Formula: C24H27N3O2

Molecular Weight: 389.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1c(-c2cccc(CN3CCOCC3)c2)cnc(N)c1-c1ccc(O)cc1

Standard InChI:  InChI=1S/C24H27N3O2/c1-2-21-22(15-26-24(25)23(21)18-6-8-20(28)9-7-18)19-5-3-4-17(14-19)16-27-10-12-29-13-11-27/h3-9,14-15,28H,2,10-13,16H2,1H3,(H2,25,26)

Standard InChI Key:  OAFJOHJSFZFEHL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.5032    1.4460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7891    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7891    0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5047   -0.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5047   -1.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2223   -1.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9337   -1.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6493   -1.4420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9337   -0.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2205    0.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0762   -0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0762   -1.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7919   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    0.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    1.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0716    1.4461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3581   -0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3581   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0693   -1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867   -1.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7867   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0711    0.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5022    0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2180   -0.2052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2180   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9336   -1.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6493   -1.0315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6493   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9337    0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10  4  2  0
 11  3  2  0
 11 12  1  0
 12 13  1  0
 14 11  1  0
 15 14  2  0
 16 15  1  0
  2 16  2  0
 14 17  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 17 22  1  0
 21 23  1  0
 23 24  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 29 28  1  0
 24 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287355

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 389.50Molecular Weight (Monoisotopic): 389.2103AlogP: 4.10#Rotatable Bonds: 5
Polar Surface Area: 71.61Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.76CX Basic pKa: 7.26CX LogP: 4.19CX LogD: 3.93
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -0.56

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source