1-(3-((4-amino-6-((2-methoxyphenethyl)amino)-1,3,5-triazin-2-yl)methoxy)-5-methylphenyl)pyrrolidin-2-one

ID: ALA5287358

Max Phase: Preclinical

Molecular Formula: C24H28N6O3

Molecular Weight: 448.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1CCNc1nc(N)nc(COc2cc(C)cc(N3CCCC3=O)c2)n1

Standard InChI:  InChI=1S/C24H28N6O3/c1-16-12-18(30-11-5-8-22(30)31)14-19(13-16)33-15-21-27-23(25)29-24(28-21)26-10-9-17-6-3-4-7-20(17)32-2/h3-4,6-7,12-14H,5,8-11,15H2,1-2H3,(H3,25,26,27,28,29)

Standard InChI Key:  VUBLCPVKBQUOAL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -5.6426   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6426   -1.0305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9292   -1.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2222   -1.0268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2222   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9310    0.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5105    0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7989   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0873    0.2057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3757   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6639    0.2055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0450   -0.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7567    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4683   -0.2047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1799    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1801    1.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8900    1.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8900    2.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6018    1.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6034    0.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8945   -0.2064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3150   -0.2025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0266    0.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6427   -0.3606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3134   -1.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4927   -1.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9117   -1.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0450   -1.0266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6621   -1.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3757   -1.0303    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6621   -2.2585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9310    1.0267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6427    1.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 17 18  1  0
 19 17  2  0
 20 19  1  0
 21 20  2  0
 15 21  1  0
 22 20  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  0
 22 26  1  0
 26 27  2  0
 28 12  2  0
 29 28  1  0
 30 29  2  0
 10 30  1  0
 29 31  1  0
  6 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287358

    ---

Associated Targets(Human)

FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.53Molecular Weight (Monoisotopic): 448.2223AlogP: 3.13#Rotatable Bonds: 9
Polar Surface Area: 115.49Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.17CX LogP: 3.48CX LogD: 3.48
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.51Np Likeness Score: -1.47

References

1. Lückmann M, Shenol A, Nissen TAD, Petersen JE, Kouvchinov D, Schwartz TW, Frimurer TM..  (2022)  Optimization of First-in-Class Dual-Acting FFAR1/FFAR4 Allosteric Modulators with Novel Mode of Action.,  13  (12.0): [PMID:36518697] [10.1021/acsmedchemlett.2c00160]

Source