3-((1-(2-benzylbutanoyl)-4-hydroxypiperidin-4-yl)methyl)pyrrolo[2,1-f][1,2,4]triazin-4(3H)-one

ID: ALA5287386

Max Phase: Preclinical

Molecular Formula: C23H28N4O3

Molecular Weight: 408.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(Cc1ccccc1)C(=O)N1CCC(O)(Cn2cnn3cccc3c2=O)CC1

Standard InChI:  InChI=1S/C23H28N4O3/c1-2-19(15-18-7-4-3-5-8-18)21(28)25-13-10-23(30,11-14-25)16-26-17-24-27-12-6-9-20(27)22(26)29/h3-9,12,17,19,30H,2,10-11,13-16H2,1H3

Standard InChI Key:  JKHLJKWNRKCHDG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    1.3528   -1.6496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3528   -0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6384   -0.4121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0761   -0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7905   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7905    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5049    0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2195    0.4128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2195   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9295   -0.8238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6458   -0.4158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6458    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4317    0.6592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9256   -0.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4530   -0.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9312    0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9312    1.6496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7905    1.2379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0761    0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6384    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0673   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0673    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7818    0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7818   -0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4963   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4963    0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2093    0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9256    0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9256   -0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2139   -0.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  1  0
 12 13  2  0
 13 14  1  0
 15 14  2  0
 11 15  1  0
 16 12  1  0
  8 16  1  0
 16 17  2  0
  6 18  1  0
 19  6  1  0
 20 19  1  0
  3 20  1  0
  2 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 24 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287386

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.50Molecular Weight (Monoisotopic): 408.2161AlogP: 2.12#Rotatable Bonds: 6
Polar Surface Area: 79.84Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.48CX LogP: 1.53CX LogD: 1.53
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -0.84

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source