The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(6S)-N-benzyl-6-(4-hydroxybenzyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4-oxohexahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1(6H)-carboxamide ID: ALA5287394
Max Phase: Preclinical
Molecular Formula: C33H35N5O3
Molecular Weight: 549.68
Associated Items:
Names and Identifiers Canonical SMILES: CN1CC(=O)N2C(CN(Cc3cccc4ccccc34)C[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCc1ccccc1
Standard InChI: InChI=1S/C33H35N5O3/c1-35-23-32(40)37-28(18-24-14-16-29(39)17-15-24)21-36(20-27-12-7-11-26-10-5-6-13-30(26)27)22-31(37)38(35)33(41)34-19-25-8-3-2-4-9-25/h2-17,28,31,39H,18-23H2,1H3,(H,34,41)/t28-,31?/m0/s1
Standard InChI Key: WFDOLRKAHYXPJC-NPHAVVRNSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
-0.7170 -1.6517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7170 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 -0.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 0.4106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7169 0.8231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0025 0.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7118 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4263 0.4106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1407 1.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8582 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5778 1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 2.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 2.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5631 3.3015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8582 2.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1417 3.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4271 2.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4271 2.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4263 -0.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7118 -0.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7118 -1.6517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4262 -2.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4262 -2.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1426 -3.3008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8528 -2.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5672 -3.3015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8528 -2.0638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1408 -1.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0025 -0.4142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7169 1.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0025 2.0606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4314 2.0606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1459 1.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8603 2.0606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5702 1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 2.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 2.8851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5720 3.2973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8603 2.8856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1459 0.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 7 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
16 15 1 0
11 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 10 2 0
20 8 1 0
21 20 1 0
21 22 1 6
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 1 0
26 28 2 0
28 29 1 0
29 23 2 0
30 21 1 0
2 30 1 0
30 6 1 0
31 5 1 0
31 32 2 0
33 31 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 2 0
38 37 1 0
39 38 2 0
40 39 1 0
35 40 2 0
4 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 549.68Molecular Weight (Monoisotopic): 549.2740AlogP: 4.20#Rotatable Bonds: 6Polar Surface Area: 79.36Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.51CX Basic pKa: 7.02CX LogP: 4.28CX LogD: 4.12Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.38Np Likeness Score: -0.61
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]