(6S)-N-benzyl-6-(4-hydroxybenzyl)-2-methyl-8-(naphthalen-1-ylmethyl)-4-oxohexahydro-2H-pyrazino[2,1-c][1,2,4]triazine-1(6H)-carboxamide

ID: ALA5287394

Max Phase: Preclinical

Molecular Formula: C33H35N5O3

Molecular Weight: 549.68

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CC(=O)N2C(CN(Cc3cccc4ccccc34)C[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C33H35N5O3/c1-35-23-32(40)37-28(18-24-14-16-29(39)17-15-24)21-36(20-27-12-7-11-26-10-5-6-13-30(26)27)22-31(37)38(35)33(41)34-19-25-8-3-2-4-9-25/h2-17,28,31,39H,18-23H2,1H3,(H,34,41)/t28-,31?/m0/s1

Standard InChI Key:  WFDOLRKAHYXPJC-NPHAVVRNSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   -0.7170   -1.6517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7170   -0.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4314   -0.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4314    0.4106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7169    0.8231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025    0.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7118    0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4263    0.4106    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407    0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1407    1.6480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5778    1.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864    2.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2864    2.8935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5631    3.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    2.8868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417    3.2959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4271    2.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4271    2.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4263   -0.4143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7118   -0.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7118   -1.6517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4262   -2.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4262   -2.8927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426   -3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8528   -2.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5672   -3.3015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8528   -2.0638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1408   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025   -0.4142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7169    1.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0025    2.0606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4314    2.0606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1459    1.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8603    2.0606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5702    1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2864    2.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2864    2.8851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720    3.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8603    2.8856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1459    0.8231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  6  7  1  0
  8  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 11 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 10  2  0
 20  8  1  0
 21 20  1  0
 21 22  1  6
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 28 29  1  0
 29 23  2  0
 30 21  1  0
  2 30  1  0
 30  6  1  0
 31  5  1  0
 31 32  2  0
 33 31  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 40 39  1  0
 35 40  2  0
  4 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287394

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.68Molecular Weight (Monoisotopic): 549.2740AlogP: 4.20#Rotatable Bonds: 6
Polar Surface Area: 79.36Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.51CX Basic pKa: 7.02CX LogP: 4.28CX LogD: 4.12
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.38Np Likeness Score: -0.61

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source