2-((3,5-dichloropyridin-4-yl)thio)-N-(1,1-dioxidobenzo[b]thiophen-6-yl)-4-(trifluoromethyl)thiazole-5-carboxamide

ID: ALA5287401

Max Phase: Preclinical

Molecular Formula: C18H8Cl2F3N3O3S3

Molecular Weight: 538.38

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc2c(c1)S(=O)(=O)C=C2)c1sc(Sc2c(Cl)cncc2Cl)nc1C(F)(F)F

Standard InChI:  InChI=1S/C18H8Cl2F3N3O3S3/c19-10-6-24-7-11(20)13(10)30-17-26-15(18(21,22)23)14(31-17)16(27)25-9-2-1-8-3-4-32(28,29)12(8)5-9/h1-7H,(H,25,27)

Standard InChI Key:  JYOCKOOPAZYMAA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.5396   -1.1856    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.3365   -1.3991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9198   -0.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7202   -1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9290   -1.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3474   -2.4070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5501   -2.1934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3036   -0.4465    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.7063   -0.0185    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9093    0.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416   -0.2970    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5878    0.1737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8381    0.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6634    0.9780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4255    1.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8381    2.4070    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.3994    1.6925    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0129    2.4070    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.2090   -0.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4226   -0.8368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7924    0.5435    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5894    0.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1730    0.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9674    0.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6796    1.1495    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.2677    1.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0928    1.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3036    0.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0010   -0.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1810   -0.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6016   -0.6791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8039   -0.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  4  8  1  0
  9  3  1  0
 10  9  1  0
 10 11  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 14 10  2  0
 13 15  1  0
 15 16  1  0
 15 17  1  0
 15 18  1  0
 12 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 25 27  2  0
 25 28  1  0
 29 28  2  0
 30 29  1  0
 30 24  2  0
 31 30  1  0
 32 31  2  0
 22 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287401

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.38Molecular Weight (Monoisotopic): 536.9057AlogP: 6.03#Rotatable Bonds: 4
Polar Surface Area: 89.02Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.01CX Basic pKa: 1.12CX LogP: 5.19CX LogD: 5.19
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.31

References

1. Li P, Liu HM..  (2020)  Recent advances in the development of ubiquitin-specific-processing protease 7 (USP7) inhibitors.,  191  [PMID:32092586] [10.1016/j.ejmech.2020.112107]

Source