The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-18-((4-hydroxy-3-methoxybenzyl)amino)-18-oxooctadec-9-en-7-yl 2-phenylacetate ID: ALA5287402
Max Phase: Preclinical
Molecular Formula: C34H49NO5
Molecular Weight: 551.77
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC[C@@H](C/C=C\CCCCCCCC(=O)NCc1ccc(O)c(OC)c1)OC(=O)Cc1ccccc1
Standard InChI: InChI=1S/C34H49NO5/c1-3-4-5-15-20-30(40-34(38)26-28-18-13-12-14-19-28)21-16-10-8-6-7-9-11-17-22-33(37)35-27-29-23-24-31(36)32(25-29)39-2/h10,12-14,16,18-19,23-25,30,36H,3-9,11,15,17,20-22,26-27H2,1-2H3,(H,35,37)/b16-10-/t30-/m0/s1
Standard InChI Key: LXLBUUJANYSIKU-LWPJEQRWSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
-4.6437 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9291 2.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 0.6197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6437 1.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 -0.2054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2127 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3583 0.6152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5025 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 1.8567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3586 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 3.0944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7852 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 2.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3583 1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3583 1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 -1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 -1.8566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 -2.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 -3.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9291 1.0315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7852 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7850 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0720 -0.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3556 0.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0674 1.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
5 7 1 0
7 8 1 0
6 9 1 0
3 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
24 31 1 6
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.77Molecular Weight (Monoisotopic): 551.3611AlogP: 7.82#Rotatable Bonds: 21Polar Surface Area: 84.86Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.93CX Basic pKa: ┄CX LogP: 8.35CX LogD: 8.35Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.09Np Likeness Score: 0.62
References 1. Richbart SD, Friedman JR, Brown KC, Gadepalli RS, Miles SL, Rimoldi JM, Rankin GO, Valentovic MA, Tirona MT, Finch PT, Hess JA, Dasgupta P.. (2021) Nonpungent N-AVAM Capsaicin Analogues and Cancer Therapy., 64 (3.0): [PMID:33508189 ] [10.1021/acs.jmedchem.0c01679 ]