The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3S)-2-[[(1S)-1-[3-[(1R)-1-amino-2-hydroxy-ethyl]-1,2,4-oxadiazol-5-yl]-4-oxo-4-(propylamino)butyl]carbamoylamino]-3-hydroxy-butanoic acid ID: ALA5287411
Max Phase: Preclinical
Molecular Formula: C16H28N6O7
Molecular Weight: 416.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCNC(=O)CC[C@H](NC(=O)N[C@H](C(=O)O)[C@H](C)O)c1nc([C@@H](N)CO)no1
Standard InChI: InChI=1S/C16H28N6O7/c1-3-6-18-11(25)5-4-10(14-21-13(22-29-14)9(17)7-23)19-16(28)20-12(8(2)24)15(26)27/h8-10,12,23-24H,3-7,17H2,1-2H3,(H,18,25)(H,26,27)(H2,19,20,28)/t8-,9-,10-,12-/m0/s1
Standard InChI Key: YZLYUYDWVJSYRO-GMOBBJLQSA-N
Molfile:
RDKit 2D
29 29 0 0 0 0 0 0 0 0999 V2000
-3.6352 -0.0794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9207 0.3329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2060 -0.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4525 0.2558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9005 -0.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3129 -1.0714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1198 -0.8999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0758 -0.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3365 0.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0758 1.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3365 1.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3365 -1.0713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1612 -1.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5736 -1.7855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3983 -1.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8107 -2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6354 -2.4998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3983 -3.2140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8107 -1.0713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3983 -0.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6354 -1.0713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5736 -0.3571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9207 1.1582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6354 1.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0758 2.4998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1612 1.7855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9005 2.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3129 3.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1376 3.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
4 3 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 3 2 0
5 8 1 0
8 9 1 6
9 10 1 0
10 11 1 0
8 12 1 0
12 13 1 0
13 14 1 0
15 14 1 1
15 16 1 0
16 17 1 0
16 18 2 0
15 19 1 0
19 20 1 0
19 21 1 6
13 22 2 0
2 23 1 1
23 24 1 0
11 25 1 0
11 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.44Molecular Weight (Monoisotopic): 416.2019AlogP: -1.46#Rotatable Bonds: 12Polar Surface Area: 212.93Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.50CX Basic pKa: 6.97CX LogP: -4.60CX LogD: -5.07Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.21Np Likeness Score: -0.79
References 1. Wu C, Cao X, Zhang X.. (2021) VISTA inhibitors in cancer immunotherapy: a short perspective on recent progresses., 12 (10.0): [PMID:34778768 ] [10.1039/D1MD00185J ]