(6-(but-2-yn-1-yloxy)benzofuran-2-yl)(2,4-dichlorophenyl)(pyridin-3-yl)methanol

ID: ALA5287457

Max Phase: Preclinical

Molecular Formula: C24H17Cl2NO3

Molecular Weight: 438.31

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC#CCOc1ccc2cc(C(O)(c3cccnc3)c3ccc(Cl)cc3Cl)oc2c1

Standard InChI:  InChI=1S/C24H17Cl2NO3/c1-2-3-11-29-19-8-6-16-12-23(30-22(16)14-19)24(28,17-5-4-10-27-15-17)20-9-7-18(25)13-21(20)26/h4-10,12-15,28H,11H2,1H3

Standard InChI Key:  BSUSEFHHPQGAOV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   -0.8010    0.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0865    0.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6253    0.0567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6253   -0.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0846   -1.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8010   -0.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4101   -1.0235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4101    0.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8951   -0.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5157   -1.1847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2303   -0.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7203   -0.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1329    0.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1329   -1.0705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7205    1.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1325    1.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9579    1.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3699    1.0752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9616    0.3586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9581   -1.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3688   -1.7837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9561   -2.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1350   -2.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7185   -1.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5455   -0.3560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3742   -0.3560    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.3705    2.5001    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.9449   -1.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6596   -1.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3742   -2.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  6 10  1  0
 10 11  1  0
  9 12  1  0
 12 13  1  0
 12 14  1  0
 15 13  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 13 19  1  0
 20 14  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 14 24  1  0
 12 25  1  0
 19 26  1  0
 17 27  1  0
 11 28  1  0
 28 29  3  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287457

    ---

Associated Targets(Human)

CYP19A1 Tclin Cytochrome P450 19A1 (6099 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.31Molecular Weight (Monoisotopic): 437.0585AlogP: 5.82#Rotatable Bonds: 5
Polar Surface Area: 55.49Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.38CX Basic pKa: 4.60CX LogP: 5.61CX LogD: 5.61
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -0.37

References

1. Eissa AG, Powell LE, Gee J, Foster PA, Simons C..  (2023)  Pyridine based dual binding site aromatase (CYP19A1) inhibitors.,  14  (2.0): [PMID:36846364] [10.1039/d2md00352j]

Source