3,5-di(benzylidene)-1-(4-(3-(4-chlorophenyl)-3-oxoprop-1-en-1-yl)benzoyl)piperidin-4-one

ID: ALA5287486

Max Phase: Preclinical

Molecular Formula: C35H26ClNO3

Molecular Weight: 544.05

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccccc2)CN(C(=O)c2ccc(/C=C/C(=O)c3ccc(Cl)cc3)cc2)C/C1=C\c1ccccc1

Standard InChI:  InChI=1S/C35H26ClNO3/c36-32-18-16-28(17-19-32)33(38)20-13-25-11-14-29(15-12-25)35(40)37-23-30(21-26-7-3-1-4-8-26)34(39)31(24-37)22-27-9-5-2-6-10-27/h1-22H,23-24H2/b20-13+,30-21+,31-22+

Standard InChI Key:  FPEMUEDCPCBZJD-ROOOYFERSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   -5.3463    0.8254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6315    0.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9199    0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9199    1.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6361    2.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3463    1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2071    2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939    1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808    2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808    2.8818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0678    1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547    2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3583    1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0715    2.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7822    1.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7822    0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0734    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3583    0.8197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0678    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808    0.4116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7808   -0.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0678   -0.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3545   -0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3560   -0.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3560   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3527   -2.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0678   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0690   -2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7822   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4953   -2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2083   -1.6467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2086   -0.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9199   -0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6332   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6348   -1.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9245   -2.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4953   -2.8818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4939   -0.8234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3463   -0.4136    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  2  0
  9  8  1  0
  9 10  2  0
 11  9  1  0
 11 12  2  0
 12 13  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 19 11  1  0
 20 19  1  0
 21 20  1  0
  8 21  1  0
 20 22  1  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 26 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 31 38  2  0
 22 39  2  0
 35 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5287486

    ---

Associated Targets(Human)

CCRF-CEM (65223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.05Molecular Weight (Monoisotopic): 543.1601AlogP: 7.43#Rotatable Bonds: 6
Polar Surface Area: 54.45Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.88CX LogD: 7.88
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -0.46

References

1. Moreira J, Saraiva L, Pinto MM, Cidade H..  (2020)  Diarylpentanoids with antitumor activity: A critical review of structure-activity relationship studies.,  192  [PMID:32172081] [10.1016/j.ejmech.2020.112177]

Source