The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5-(4-(4-fluorophenyl)-6-(4-hydroxyphenyl)-2-thioxo-5,6-dihydropyrimidin-1(2H)-yl)-1,2-dihydro-1,2,4-triazin-3(6H)-one) ID: ALA5287507
Max Phase: Preclinical
Molecular Formula: C19H16FN5O2S
Molecular Weight: 397.44
Associated Items:
Names and Identifiers Canonical SMILES: O=C1N=C(N2C(=S)N=C(c3ccc(F)cc3)CC2c2ccc(O)cc2)CNN1
Standard InChI: InChI=1S/C19H16FN5O2S/c20-13-5-1-11(2-6-13)15-9-16(12-3-7-14(26)8-4-12)25(19(28)22-15)17-10-21-24-18(27)23-17/h1-8,16,21,26H,9-10H2,(H,24,27)
Standard InChI Key: QRQUXTZYNDALOV-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
-2.8450 -0.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8450 -1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1317 -2.0516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4245 -1.6415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4245 -0.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1334 -0.4096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7129 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -0.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7102 -0.4089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7102 0.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7129 0.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 1.6452 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 0.4126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 0.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8450 1.6451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1334 2.0560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 1.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5566 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 -0.8198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 -1.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1353 -2.0515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8427 -1.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8427 -0.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1336 -0.4091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5543 -2.0522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5566 -2.0560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
7 5 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
7 12 2 0
11 13 2 0
14 10 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 19 1 0
16 20 2 0
21 9 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 21 2 0
24 27 1 0
2 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.44Molecular Weight (Monoisotopic): 397.1009AlogP: 2.68#Rotatable Bonds: 2Polar Surface Area: 89.32Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.59CX Basic pKa: 1.26CX LogP: 2.25CX LogD: 2.23Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -0.60
References 1. Pal R, Singh K, Khan SA, Chawla P, Kumar B, Akhtar MJ.. (2021) Reactive metabolites of the anticonvulsant drugs and approaches to minimize the adverse drug reaction., 226 [PMID:34628237 ] [10.1016/j.ejmech.2021.113890 ]