The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-chloro-N1-(3-methylbenzyl)-N3-phenylisophthalamide ID: ALA5287514
Max Phase: Preclinical
Molecular Formula: C22H19ClN2O2
Molecular Weight: 378.86
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(CNC(=O)c2ccc(Cl)c(C(=O)Nc3ccccc3)c2)c1
Standard InChI: InChI=1S/C22H19ClN2O2/c1-15-6-5-7-16(12-15)14-24-21(26)17-10-11-20(23)19(13-17)22(27)25-18-8-3-2-4-9-18/h2-13H,14H2,1H3,(H,24,26)(H,25,27)
Standard InChI Key: QJGUAEWTHPWKAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
-2.1425 1.0334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4280 -0.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4280 -1.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 -1.4452 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.7115 -1.4408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 -0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 0.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4276 -0.2037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1421 0.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8566 -0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8566 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5731 -1.4404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -1.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2833 -0.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5712 0.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9977 0.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 1.0338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7133 0.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8569 -0.2041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5715 0.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2814 -0.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9977 0.2047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9977 1.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2833 1.4452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5715 1.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
16 18 1 0
9 19 2 0
8 20 1 0
20 3 2 0
21 2 1 0
22 21 1 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
22 27 2 0
27 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 378.86Molecular Weight (Monoisotopic): 378.1135AlogP: 4.83#Rotatable Bonds: 5Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.98CX Basic pKa: ┄CX LogP: 4.98CX LogD: 4.98Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.67Np Likeness Score: -1.73
References 1. Orsi DL, Ferrara SJ, Siegel S, Friberg A, Bouché L, Pook E, Lienau P, Bluck JP, Lemke CT, Akcay G, Stellfeld T, Meyer H, Pütter V, Holton SJ, Korr D, Jerchel-Furau I, Pantelidou C, Strathdee CA, Meyerson M, Eis K, Goldstein JT.. (2023) Discovery and characterization of orally bioavailable 4-chloro-6-fluoroisophthalamides as covalent PPARG inverse-agonists., 78 [PMID:36542958 ] [10.1016/j.bmc.2022.117130 ]